The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(((2R,3S,4R,5R)-5-(2-chloro-6-((1-methyl-1H-pyrazol-4-yl)methylamino)-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methoxy)methylphosphonic acid ID: ALA4782237
PubChem CID: 153325460
Max Phase: Preclinical
Molecular Formula: C16H21ClN7O7P
Molecular Weight: 489.81
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(CNc2nc(Cl)nc3c2ncn3[C@@H]2O[C@H](COCP(=O)(O)O)[C@@H](O)[C@H]2O)cn1
Standard InChI: InChI=1S/C16H21ClN7O7P/c1-23-4-8(3-20-23)2-18-13-10-14(22-16(17)21-13)24(6-19-10)15-12(26)11(25)9(31-15)5-30-7-32(27,28)29/h3-4,6,9,11-12,15,25-26H,2,5,7H2,1H3,(H,18,21,22)(H2,27,28,29)/t9-,11-,12-,15-/m1/s1
Standard InChI Key: QFNKMQZMYFPSSK-SDBHATRESA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
8.3532 -11.3237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0629 -10.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0601 -10.0916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3514 -9.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6452 -10.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6464 -10.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8702 -9.8447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3892 -10.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8682 -11.1658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7712 -11.3217 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.3477 -8.8691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0535 -8.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7631 -8.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6183 -11.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8408 -12.1957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8396 -13.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6165 -13.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0977 -12.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8679 -14.0441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9149 -12.6073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1778 -13.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4317 -13.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7699 -13.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8541 -14.4510 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.1923 -14.9303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6002 -14.7845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2688 -13.8675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8536 -9.6723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6537 -9.8385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0590 -9.1289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5094 -8.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9895 -10.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
2 10 1 0
4 11 1 0
11 12 1 0
12 13 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
14 9 1 1
17 19 1 6
18 20 1 6
16 21 1 1
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
24 27 1 0
13 28 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 13 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.81Molecular Weight (Monoisotopic): 489.0929AlogP: -0.40#Rotatable Bonds: 8Polar Surface Area: 189.90Molecular Species: ACIDHBA: 12HBD: 5#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.35CX Basic pKa: 2.31CX LogP: -2.65CX LogD: -3.85Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.20Np Likeness Score: -0.26
References 1. Sharif EU,Kalisiak J,Lawson KV,Miles DH,Newcomb E,Lindsey EA,Rosen BR,Debien LPP,Chen A,Zhao X,Young SW,Walker NP,Sträter N,Scaletti ER,Jin L,Xu G,Leleti MR,Powers JP. (2021) Discovery of Potent and Selective Methylenephosphonic Acid CD73 Inhibitors., 64 (1.0): [PMID:33399453 ] [10.1021/acs.jmedchem.0c01835 ]