The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{[4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl](methyl)amino}-4-hydroxy-1-morpholinobutan-1-one ID: ALA4782298
PubChem CID: 162664269
Max Phase: Preclinical
Molecular Formula: C23H32N2O3S2
Molecular Weight: 448.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccsc1C(=CCCN(C)C(CCO)C(=O)N1CCOCC1)c1sccc1C
Standard InChI: InChI=1S/C23H32N2O3S2/c1-17-7-15-29-21(17)19(22-18(2)8-16-30-22)5-4-9-24(3)20(6-12-26)23(27)25-10-13-28-14-11-25/h5,7-8,15-16,20,26H,4,6,9-14H2,1-3H3
Standard InChI Key: GYGJFSPUYSUFIT-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
4.1291 -3.5666 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.9540 -3.5666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2108 -2.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5415 -2.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8765 -2.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4381 -4.2346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2587 -4.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1018 -4.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2957 -5.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2085 -5.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9618 -6.3109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5145 -5.6984 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.9958 -2.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6847 -4.5998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7428 -4.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5634 -4.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0476 -5.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8681 -5.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7111 -6.1533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3522 -5.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2045 -4.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0250 -4.4762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7204 -3.8935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0158 -6.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4999 -7.4040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5097 -5.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3269 -5.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6673 -4.3141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1843 -3.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3607 -3.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
2 6 1 0
6 7 2 0
6 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
3 13 1 0
9 14 1 0
7 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 1 0
18 20 1 0
18 21 1 0
21 22 1 0
21 23 2 0
20 24 1 0
24 25 1 0
22 26 1 0
22 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.65Molecular Weight (Monoisotopic): 448.1854AlogP: 3.79#Rotatable Bonds: 9Polar Surface Area: 53.01Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.08CX LogP: 3.58CX LogD: 2.82Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -0.69
References 1. Zaręba P,Gryzło B,Malawska K,Sałat K,Höfner GC,Nowaczyk A,Fijałkowski Ł,Rapacz A,Podkowa A,Furgała A,Żmudzki P,Wanner KT,Malawska B,Kulig K. (2020) Novel mouse GABA uptake inhibitors with enhanced inhibitory activity toward mGAT3/4 and their effect on pain threshold in mice., 188 [PMID:31901745 ] [10.1016/j.ejmech.2019.111920 ]