2-{[4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl](methyl)amino}-4-hydroxy-1-morpholinobutan-1-one

ID: ALA4782298

PubChem CID: 162664269

Max Phase: Preclinical

Molecular Formula: C23H32N2O3S2

Molecular Weight: 448.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccsc1C(=CCCN(C)C(CCO)C(=O)N1CCOCC1)c1sccc1C

Standard InChI:  InChI=1S/C23H32N2O3S2/c1-17-7-15-29-21(17)19(22-18(2)8-16-30-22)5-4-9-24(3)20(6-12-26)23(27)25-10-13-28-14-11-25/h5,7-8,15-16,20,26H,4,6,9-14H2,1-3H3

Standard InChI Key:  GYGJFSPUYSUFIT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    4.1291   -3.5666    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.9540   -3.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2108   -2.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5415   -2.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8765   -2.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4381   -4.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2587   -4.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1018   -4.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2957   -5.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2085   -5.9744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9618   -6.3109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5145   -5.6984    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.9958   -2.5287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6847   -4.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7428   -4.8173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5634   -4.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0476   -5.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8681   -5.3148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7111   -6.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3522   -5.9827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2045   -4.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0250   -4.4762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7204   -3.8935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0158   -6.7360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4999   -7.4040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5097   -5.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3269   -5.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6673   -4.3141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1843   -3.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3607   -3.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  2  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
  3 13  1  0
  9 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  2  0
 20 24  1  0
 24 25  1  0
 22 26  1  0
 22 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4782298

    ---

Associated Targets(non-human)

Slc6a11 GABA transporter 4 (930 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a1 GABA transporter 1 (1980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a13 GABA transporter 3 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.65Molecular Weight (Monoisotopic): 448.1854AlogP: 3.79#Rotatable Bonds: 9
Polar Surface Area: 53.01Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.08CX LogP: 3.58CX LogD: 2.82
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -0.69

References

1. Zaręba P,Gryzło B,Malawska K,Sałat K,Höfner GC,Nowaczyk A,Fijałkowski Ł,Rapacz A,Podkowa A,Furgała A,Żmudzki P,Wanner KT,Malawska B,Kulig K.  (2020)  Novel mouse GABA uptake inhibitors with enhanced inhibitory activity toward mGAT3/4 and their effect on pain threshold in mice.,  188  [PMID:31901745] [10.1016/j.ejmech.2019.111920]

Source