Ethyl (6-nitro-1H-benzo[d]imidazol-2-yl)glycinate

ID: ALA4782322

PubChem CID: 80162139

Max Phase: Preclinical

Molecular Formula: C11H12N4O4

Molecular Weight: 264.24

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CNc1nc2ccc([N+](=O)[O-])cc2[nH]1

Standard InChI:  InChI=1S/C11H12N4O4/c1-2-19-10(16)6-12-11-13-8-4-3-7(15(17)18)5-9(8)14-11/h3-5H,2,6H2,1H3,(H2,12,13,14)

Standard InChI Key:  AOSVEWIIYOPNFF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   25.8690  -20.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8678  -21.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5826  -22.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5809  -20.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2962  -20.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2964  -21.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0869  -21.9086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5752  -21.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0865  -20.5640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3994  -21.2386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8140  -20.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1537  -20.4126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4393  -20.8252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1535  -19.5876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6390  -20.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0488  -21.2392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0531  -19.8102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.8738  -21.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2857  -21.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 12 13  2  0
 12 14  1  0
  1 12  1  0
 11 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
M  CHG  2  12   1  14  -1
M  END

Alternative Forms

Associated Targets(Human)

RIPK1 Tchem Receptor-interacting serine/threonine-protein kinase 1 (1548 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 264.24Molecular Weight (Monoisotopic): 264.0859AlogP: 1.45#Rotatable Bonds: 5
Polar Surface Area: 110.15Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.75CX Basic pKa: 4.30CX LogP: 1.34CX LogD: 1.20
Aromatic Rings: 2Heavy Atoms: 19QED Weighted: 0.48Np Likeness Score: -1.61

References

1. Benchekroun M,Ermolenko L,Tran MQ,Vagneux A,Nedev H,Delehouzé C,Souab M,Baratte B,Josselin B,Iorga BI,Ruchaud S,Bach S,Al-Mourabit A.  (2020)  Discovery of simplified benzazole fragments derived from the marine benzosceptrin B as necroptosis inhibitors involving the receptor interacting protein Kinase-1.,  201  [PMID:32659605] [10.1016/j.ejmech.2020.112337]

Source