The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-methyl-N-(4-(2-phenyl-1-(4-(2-(pyrrolidin-1-yl)ethoxy)phenyl)but-1-enyl)phenyl)pyrrolidine-3-carboxamide ID: ALA4782391
PubChem CID: 162663958
Max Phase: Preclinical
Molecular Formula: C34H41N3O2
Molecular Weight: 523.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC/C(=C(/c1ccc(NC(=O)C2CCN(C)C2)cc1)c1ccc(OCCN2CCCC2)cc1)c1ccccc1
Standard InChI: InChI=1S/C34H41N3O2/c1-3-32(26-9-5-4-6-10-26)33(28-13-17-31(18-14-28)39-24-23-37-20-7-8-21-37)27-11-15-30(16-12-27)35-34(38)29-19-22-36(2)25-29/h4-6,9-18,29H,3,7-8,19-25H2,1-2H3,(H,35,38)/b33-32+
Standard InChI Key: FJBQHGUWSRWRCM-ULIFNZDWSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
17.7670 -7.3671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9645 -7.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8642 -8.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6071 -8.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1619 -8.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1533 -8.7289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4505 -8.3109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1369 -9.5459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4218 -9.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7231 -9.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0080 -9.9217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9957 -10.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6944 -11.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4095 -10.7619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2807 -11.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2684 -11.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5533 -12.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5410 -13.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5779 -10.7156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5943 -9.8985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8915 -9.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1764 -9.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1641 -10.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8628 -11.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4777 -9.4532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7626 -9.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0598 -9.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3489 -9.8248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6060 -9.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0512 -10.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4461 -10.7959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2486 -10.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9670 -12.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9548 -13.1898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6534 -13.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3685 -13.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3849 -12.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6821 -11.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1119 -6.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 2 0
6 8 1 0
3 6 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
15 16 2 0
16 17 1 0
17 18 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
26 27 1 0
25 26 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
28 32 1 0
27 28 1 0
22 25 1 0
15 19 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
33 38 2 0
16 33 1 0
12 15 1 0
8 9 1 0
1 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.72Molecular Weight (Monoisotopic): 523.3199AlogP: 6.42#Rotatable Bonds: 10Polar Surface Area: 44.81Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.89CX Basic pKa: 9.36CX LogP: 6.19CX LogD: 2.89Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: -1.03
References 1. Cooper L,Schafer A,Li Y,Cheng H,Medegan Fagla B,Shen Z,Nowar R,Dye K,Anantpadma M,Davey RA,Thatcher GRJ,Rong L,Xiong R. (2020) Screening and Reverse-Engineering of Estrogen Receptor Ligands as Potent Pan-Filovirus Inhibitors., 63 (19.0): [PMID:32886512 ] [10.1021/acs.jmedchem.0c01001 ]