The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Voruciclib ID: ALA4782409
PubChem CID: 162664628
Max Phase: Preclinical
Molecular Formula: C22H20ClF3NO8P
Molecular Weight: 549.82
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN1CC[C@@H](c2c(OP(=O)(O)O)cc(O)c3c(=O)cc(-c4ccc(C(F)(F)F)cc4Cl)oc23)[C@@H]1CO
Standard InChI: InChI=1S/C22H20ClF3NO8P/c1-27-5-4-12(14(27)9-28)19-18(35-36(31,32)33)8-16(30)20-15(29)7-17(34-21(19)20)11-3-2-10(6-13(11)23)22(24,25)26/h2-3,6-8,12,14,28,30H,4-5,9H2,1H3,(H2,31,32,33)/t12-,14+/m1/s1
Standard InChI Key: WLTRIWCDHOZNRP-OCCSQVGLSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
3.6946 -20.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6934 -21.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4082 -21.8872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4064 -20.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1219 -20.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1207 -21.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8337 -21.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5525 -21.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5536 -20.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8360 -20.2277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2673 -20.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9810 -20.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6960 -20.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6985 -19.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9799 -19.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2679 -19.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4024 -19.4147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9800 -20.2345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4100 -22.7122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8314 -22.7098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9782 -21.4784 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.2656 -20.6472 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
1.5510 -20.2348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2658 -21.4722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0460 -19.8469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0638 -18.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8067 -18.1495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9873 -18.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7382 -18.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8499 -19.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4599 -18.6224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2884 -17.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4198 -19.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4198 -18.1680 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1412 -19.4174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1412 -18.5844 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 11 1 0
17 4 1 6
1 18 1 0
3 19 1 0
7 20 2 0
12 21 1 0
18 22 1 0
22 23 1 0
22 24 2 0
22 25 1 0
17 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 17 1 0
26 30 1 1
30 31 1 0
27 32 1 0
14 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.82Molecular Weight (Monoisotopic): 549.0567AlogP: 4.09#Rotatable Bonds: 5Polar Surface Area: 140.67Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.71CX Basic pKa: 7.74CX LogP: 1.85CX LogD: 0.41Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: 0.72
References 1. Wu T,Qin Z,Tian Y,Wang J,Xu C,Li Z,Bian J. (2020) Recent Developments in the Biology and Medicinal Chemistry of CDK9 Inhibitors: An Update., 63 (22): [PMID:32866383 ] [10.1021/acs.jmedchem.0c00744 ]