The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[(1S)-1-[(2S,4R)-4-hydroxy-2-[[4-(4-methylthiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidine-1-carbonyl]-2,2-dimethyl-propyl]2-phenylacetate ID: ALA4782620
PubChem CID: 162664558
Max Phase: Preclinical
Molecular Formula: C30H35N3O5S
Molecular Weight: 549.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](OC(=O)Cc2ccccc2)C(C)(C)C)cc1
Standard InChI: InChI=1S/C30H35N3O5S/c1-19-26(39-18-32-19)22-12-10-21(11-13-22)16-31-28(36)24-15-23(34)17-33(24)29(37)27(30(2,3)4)38-25(35)14-20-8-6-5-7-9-20/h5-13,18,23-24,27,34H,14-17H2,1-4H3,(H,31,36)/t23-,24+,27-/m1/s1
Standard InChI Key: QGYKSZSGBAAAIX-ONBPZOJHSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
27.6359 -5.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3546 -5.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0732 -5.9334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3546 -4.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7866 -5.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5021 -5.9297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2156 -5.5154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5042 -6.7547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7845 -4.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4980 -4.2797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0690 -4.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7792 -3.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9683 -5.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5188 -5.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1045 -4.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2979 -4.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1434 -6.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5328 -7.2057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9292 -6.9023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5398 -6.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3255 -6.5991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4970 -7.4039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2819 -7.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8934 -7.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7148 -6.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9301 -6.0428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6802 -7.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9396 -8.1332 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.7646 -8.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0150 -7.3422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3448 -6.8612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4380 -3.7622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3399 -6.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9225 -5.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9290 -4.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2164 -4.2811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5000 -4.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5005 -5.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2137 -5.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
5 9 1 1
9 10 1 0
9 11 1 0
9 12 1 0
7 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 7 1 0
13 17 1 1
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 27 2 0
24 27 1 0
15 32 1 6
31 33 1 0
1 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.69Molecular Weight (Monoisotopic): 549.2297AlogP: 3.90#Rotatable Bonds: 8Polar Surface Area: 108.83Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.65CX LogP: 3.23CX LogD: 3.23Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.41Np Likeness Score: -0.57
References 1. Klein VG,Townsend CE,Testa A,Zengerle M,Maniaci C,Hughes SJ,Chan KH,Ciulli A,Lokey RS. (2020) Understanding and Improving the Membrane Permeability of VH032-Based PROTACs., 11 (9): [PMID:32939229 ] [10.1021/acsmedchemlett.0c00265 ]