[(1S)-1-[(2S,4R)-4-hydroxy-2-[[4-(4-methylthiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidine-1-carbonyl]-2,2-dimethyl-propyl]2-phenylacetate

ID: ALA4782620

PubChem CID: 162664558

Max Phase: Preclinical

Molecular Formula: C30H35N3O5S

Molecular Weight: 549.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](OC(=O)Cc2ccccc2)C(C)(C)C)cc1

Standard InChI:  InChI=1S/C30H35N3O5S/c1-19-26(39-18-32-19)22-12-10-21(11-13-22)16-31-28(36)24-15-23(34)17-33(24)29(37)27(30(2,3)4)38-25(35)14-20-8-6-5-7-9-20/h5-13,18,23-24,27,34H,14-17H2,1-4H3,(H,31,36)/t23-,24+,27-/m1/s1

Standard InChI Key:  QGYKSZSGBAAAIX-ONBPZOJHSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   27.6359   -5.9334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3546   -5.5209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0732   -5.9334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3546   -4.6917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7866   -5.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5021   -5.9297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2156   -5.5154    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.5042   -6.7547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7845   -4.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4980   -4.2797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0690   -4.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7792   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9683   -5.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5188   -5.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1045   -4.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2979   -4.6905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1434   -6.6510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5328   -7.2057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9292   -6.9023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5398   -6.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3255   -6.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4970   -7.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2819   -7.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8934   -7.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7148   -6.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9301   -6.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6802   -7.3501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9396   -8.1332    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.7646   -8.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0150   -7.3422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.3448   -6.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4380   -3.7622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.3399   -6.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9225   -5.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9290   -4.6953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2164   -4.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5000   -4.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5005   -5.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2137   -5.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  5  9  1  1
  9 10  1  0
  9 11  1  0
  9 12  1  0
  7 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16  7  1  0
 13 17  1  1
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 27  2  0
 24 27  1  0
 15 32  1  6
 31 33  1  0
  1 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4782620

    ---

Associated Targets(Human)

VHL Tchem Von Hippel-Lindau disease tumor suppressor (136 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 549.69Molecular Weight (Monoisotopic): 549.2297AlogP: 3.90#Rotatable Bonds: 8
Polar Surface Area: 108.83Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.65CX LogP: 3.23CX LogD: 3.23
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.41Np Likeness Score: -0.57

References

1. Klein VG,Townsend CE,Testa A,Zengerle M,Maniaci C,Hughes SJ,Chan KH,Ciulli A,Lokey RS.  (2020)  Understanding and Improving the Membrane Permeability of VH032-Based PROTACs.,  11  (9): [PMID:32939229] [10.1021/acsmedchemlett.0c00265]

Source