(R)-3-(1-(3-methoxyphenyl)ethyl)-6-(1H-pyrazol-4-yl)quinazolin-4(3H)-one

ID: ALA4782910

PubChem CID: 155594083

Max Phase: Preclinical

Molecular Formula: C20H18N4O2

Molecular Weight: 346.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc([C@@H](C)n2cnc3ccc(-c4cn[nH]c4)cc3c2=O)c1

Standard InChI:  InChI=1S/C20H18N4O2/c1-13(14-4-3-5-17(8-14)26-2)24-12-21-19-7-6-15(9-18(19)20(24)25)16-10-22-23-11-16/h3-13H,1-2H3,(H,22,23)/t13-/m1/s1

Standard InChI Key:  WDTAOVYOPRSNQC-CYBMUJFWSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    2.7126  -15.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7162  -16.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4267  -16.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4153  -14.7773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1263  -15.1784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1299  -16.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8424  -16.4107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5558  -15.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5522  -15.1720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8351  -14.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8303  -13.9432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2585  -14.7610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9676  -15.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9650  -15.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6733  -16.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3806  -15.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3751  -15.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6663  -14.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0044  -14.7821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9154  -13.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1157  -13.7959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7075  -14.5041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2549  -15.1111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2557  -13.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0787  -14.7437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0730  -13.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
  9 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  1 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 19  1  0
 12 24  1  6
 25 26  1  0
 17 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4782910

    ---

Associated Targets(Human)

GRK2 Tchem G-protein coupled receptor kinase 2 (1019 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.39Molecular Weight (Monoisotopic): 346.1430AlogP: 3.40#Rotatable Bonds: 4
Polar Surface Area: 72.80Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.36CX LogP: 2.88CX LogD: 2.88
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.61Np Likeness Score: -1.21

References

1. Xu G,Gaul MD,Liu Z,DesJarlais RL,Qi J,Wang W,Krosky D,Petrounia I,Milligan CM,Hermans A,Lu HR,Huang DZ,Xu JZ,Spurlino JC.  (2020)  Hit-to-lead optimization and discovery of a potent, and orally bioavailable G protein coupled receptor kinase 2 (GRK2) inhibitor.,  30  (23): [PMID:33038544] [10.1016/j.bmcl.2020.127602]

Source