The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(diethylamino)ethyl)-2,4-dimethyl-5-((2-oxo-5-(5-phenylthiophen-2-yl)indolin-3-ylidene)methyl)thiophene-3-carboxamide ID: ALA4782977
PubChem CID: 162665165
Max Phase: Preclinical
Molecular Formula: C32H33N3O2S2
Molecular Weight: 555.77
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNC(=O)c1c(C)sc(/C=C2\C(=O)Nc3ccc(-c4ccc(-c5ccccc5)s4)cc32)c1C
Standard InChI: InChI=1S/C32H33N3O2S2/c1-5-35(6-2)17-16-33-32(37)30-20(3)29(38-21(30)4)19-25-24-18-23(12-13-26(24)34-31(25)36)28-15-14-27(39-28)22-10-8-7-9-11-22/h7-15,18-19H,5-6,16-17H2,1-4H3,(H,33,37)(H,34,36)/b25-19-
Standard InChI Key: HNFGABPBUHXKHM-PLRJNAJWSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
5.4029 -5.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4018 -6.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1166 -7.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1148 -5.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8302 -5.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8350 -6.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6226 -6.8904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1045 -6.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6147 -5.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9295 -6.2141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6924 -5.4002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6059 -4.5797 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.7989 -4.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3865 -5.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9388 -5.7359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4643 -3.6563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9508 -2.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6157 -2.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7944 -2.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3092 -2.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6470 -3.5720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8651 -4.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5752 -4.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3300 -4.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8766 -4.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4596 -3.3532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6554 -3.5305 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.5075 -5.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7896 -2.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6978 -4.1437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0388 -4.8950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1778 -3.4728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8599 -4.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2009 -5.7265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0221 -5.8067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3632 -6.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5021 -5.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1843 -6.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3233 -5.2159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 2 0
1 11 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
13 16 1 0
9 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 23 1 0
24 28 1 0
26 29 1 0
25 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 37 1 0
36 38 1 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.77Molecular Weight (Monoisotopic): 555.2014AlogP: 7.32#Rotatable Bonds: 9Polar Surface Area: 61.44Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.17CX Basic pKa: 9.04CX LogP: 7.21CX LogD: 5.56Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.21Np Likeness Score: -0.91
References 1. (2019) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer,