The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-((S)-5-guanidino-2-((S)-3-phenyl-2-((S)-pyrrolidine-2-carboxamido)propanamido)pentanoyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide ID: ALA4782986
PubChem CID: 102270377
Max Phase: Preclinical
Molecular Formula: C30H40N8O4
Molecular Weight: 576.70
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1)C(=O)N1Cc2ccccc2C[C@H]1C(N)=O
Standard InChI: InChI=1S/C30H40N8O4/c31-26(39)25-17-20-10-4-5-11-21(20)18-38(25)29(42)23(13-7-15-35-30(32)33)36-28(41)24(16-19-8-2-1-3-9-19)37-27(40)22-12-6-14-34-22/h1-5,8-11,22-25,34H,6-7,12-18H2,(H2,31,39)(H,36,41)(H,37,40)(H4,32,33,35)/t22-,23-,24-,25-/m0/s1
Standard InChI Key: WZKUPZOZUGSSGT-QORCZRPOSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
6.2800 -10.6200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9274 -10.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6649 -11.3432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6649 -10.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9260 -9.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6443 -9.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0415 -9.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3783 -10.1068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0918 -10.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8053 -9.2840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8053 -10.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0918 -11.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8053 -11.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6631 -7.6342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6631 -6.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9497 -6.3978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3766 -6.3978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5186 -10.5203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2321 -10.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9497 -11.3432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9497 -10.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2321 -9.2840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9497 -8.8705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9497 -8.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7989 -12.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5114 -12.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2272 -12.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2260 -11.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5129 -11.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6585 -10.1082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3766 -10.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0886 -10.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6525 -9.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3708 -8.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0870 -9.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8020 -8.8689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8019 -8.0416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0809 -7.6290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3690 -8.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3798 -11.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6646 -11.7661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0971 -11.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 8 1 0
11 18 1 0
21 30 1 0
1 2 1 0
2 4 1 1
4 3 2 0
2 5 1 0
6 7 1 0
7 5 1 0
6 1 1 0
8 9 1 0
9 11 1 0
11 10 2 0
9 12 1 6
12 13 1 0
14 15 1 0
15 16 1 0
15 17 2 0
18 19 1 0
19 21 1 0
21 20 2 0
19 22 1 1
22 23 1 0
23 24 1 0
24 14 1 0
13 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 13 1 0
30 31 1 0
30 33 1 0
31 32 1 0
32 35 1 0
34 33 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
40 41 1 0
40 42 2 0
31 40 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 576.70Molecular Weight (Monoisotopic): 576.3173AlogP: -0.35#Rotatable Bonds: 12Polar Surface Area: 195.53Molecular Species: BASEHBA: 6HBD: 7#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.13CX Basic pKa: 11.69CX LogP: -0.50CX LogD: -4.63Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.10Np Likeness Score: -0.16
References 1. Nguyen T,Marusich J,Li JX,Zhang Y. (2020) Neuropeptide FF and Its Receptors: Therapeutic Applications and Ligand Development., 63 (21.0): [PMID:32673481 ] [10.1021/acs.jmedchem.0c00643 ]