trans-3-Octyl-1-oxo-isochroman-4-carboxylic acid

ID: ALA478313

PubChem CID: 44582425

Max Phase: Preclinical

Molecular Formula: C18H24O4

Molecular Weight: 304.39

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC[C@@H]1OC(=O)c2ccccc2[C@H]1C(=O)O

Standard InChI:  InChI=1S/C18H24O4/c1-2-3-4-5-6-7-12-15-16(17(19)20)13-10-8-9-11-14(13)18(21)22-15/h8-11,15-16H,2-7,12H2,1H3,(H,19,20)/t15-,16+/m0/s1

Standard InChI Key:  ODUKHCYCXKLGBB-JKSUJKDBSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   -5.1389    1.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1401    0.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4253   -0.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4271    1.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7126    1.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7069    0.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9918   -0.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2778    0.2330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2836    1.0599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0032    1.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9872   -1.0082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0101    2.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3001    2.7148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7289    2.7029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5716    1.4767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8547    1.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1426    1.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5743    1.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2863    1.4936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0032    1.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7152    1.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4321    1.0938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
  7 11  2  0
 10 12  1  1
  2  3  1  0
  3  6  2  0
 12 13  1  0
 12 14  2  0
  1  2  2  0
  9 15  1  6
  5  4  2  0
 15 16  1  0
  4  1  1  0
 16 17  1  0
  5 10  1  0
 17 18  1  0
  6  7  1  0
 18 19  1  0
  7  8  1  0
 19 20  1  0
  8  9  1  0
 20 21  1  0
  9 10  1  0
 21 22  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Fasn Fatty acid synthase (89 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 304.39Molecular Weight (Monoisotopic): 304.1675AlogP: 4.14#Rotatable Bonds: 8
Polar Surface Area: 63.60Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.97CX Basic pKa: CX LogP: 4.80CX LogD: 1.62
Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.58Np Likeness Score: 0.74

References

1. Wang X, Lin J, Chen Y, Zhong W, Zhao G, Liu H, Li S, Wang L, Li S..  (2009)  Novel fatty acid synthase (FAS) inhibitors: design, synthesis, biological evaluation, and molecular docking studies.,  17  (5): [PMID:19223187] [10.1016/j.bmc.2009.01.050]

Source