(2R,3S,5R)-methyl 2-(((1s,4S)-4-(3-fluorophenyl)cyclohexyloxy)methyl)-5-methyl-3-(N-methylsulfamoylamino)pyrrolidine-1-carboxylate

ID: ALA4783256

PubChem CID: 155054704

Max Phase: Preclinical

Molecular Formula: C21H32FN3O5S

Molecular Weight: 457.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNS(=O)(=O)N[C@H]1C[C@@H](C)N(C(=O)OC)[C@H]1CO[C@H]1CC[C@@H](c2cccc(F)c2)CC1

Standard InChI:  InChI=1S/C21H32FN3O5S/c1-14-11-19(24-31(27,28)23-2)20(25(14)21(26)29-3)13-30-18-9-7-15(8-10-18)16-5-4-6-17(22)12-16/h4-6,12,14-15,18-20,23-24H,7-11,13H2,1-3H3/t14-,15-,18+,19+,20+/m1/s1

Standard InChI Key:  XNWYHWRAYIPYKI-XEGUMIITSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    9.9796  -15.7371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4018  -16.3191    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.1947  -16.5285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2156  -18.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2156  -19.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9209  -20.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6262  -19.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6262  -18.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9209  -18.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5094  -20.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8009  -19.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0942  -20.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0950  -20.9312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8082  -21.3386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5120  -20.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3351  -18.4797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0416  -18.8903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7505  -18.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4950  -18.8154    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0436  -18.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6370  -17.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8372  -17.6684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2311  -17.1204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7964  -15.7734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9679  -14.9744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8560  -18.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6637  -19.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0555  -20.1609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4405  -19.8687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2242  -20.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3861  -19.7052    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  5 10  1  1
  8 16  1  1
 16 17  1  0
 18 17  1  1
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 22 23  1  1
 23  2  1  0
  2 24  1  0
 24 25  1  0
 20 26  1  1
 19 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 12 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4783256

    ---

Associated Targets(Human)

HCRTR2 Tclin Orexin receptor 2 (5902 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.57Molecular Weight (Monoisotopic): 457.2047AlogP: 2.52#Rotatable Bonds: 7
Polar Surface Area: 96.97Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.38CX Basic pKa: 0.35CX LogP: 2.06CX LogD: 2.06
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -0.59

References

1. Sabnis RW..  (2020)  Novel 5-Alkyl Pyrrolidine Orexin Receptor Agonists for Treating Sleep Disorders.,  11  (11): [PMID:33214817] [10.1021/acsmedchemlett.0c00501]

Source