The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S,5R)-methyl 2-(((1s,4S)-4-(3-fluorophenyl)cyclohexyloxy)methyl)-5-methyl-3-(N-methylsulfamoylamino)pyrrolidine-1-carboxylate ID: ALA4783256
PubChem CID: 155054704
Max Phase: Preclinical
Molecular Formula: C21H32FN3O5S
Molecular Weight: 457.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNS(=O)(=O)N[C@H]1C[C@@H](C)N(C(=O)OC)[C@H]1CO[C@H]1CC[C@@H](c2cccc(F)c2)CC1
Standard InChI: InChI=1S/C21H32FN3O5S/c1-14-11-19(24-31(27,28)23-2)20(25(14)21(26)29-3)13-30-18-9-7-15(8-10-18)16-5-4-6-17(22)12-16/h4-6,12,14-15,18-20,23-24H,7-11,13H2,1-3H3/t14-,15-,18+,19+,20+/m1/s1
Standard InChI Key: XNWYHWRAYIPYKI-XEGUMIITSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
9.9796 -15.7371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4018 -16.3191 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.1947 -16.5285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2156 -18.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2156 -19.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9209 -20.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6262 -19.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6262 -18.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9209 -18.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5094 -20.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8009 -19.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0942 -20.1132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0950 -20.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8082 -21.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5120 -20.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3351 -18.4797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0416 -18.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7505 -18.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4950 -18.8154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0436 -18.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6370 -17.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8372 -17.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2311 -17.1204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7964 -15.7734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9679 -14.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8560 -18.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6637 -19.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0555 -20.1609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4405 -19.8687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2242 -20.9605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3861 -19.7052 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
5 10 1 1
8 16 1 1
16 17 1 0
18 17 1 1
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
22 23 1 1
23 2 1 0
2 24 1 0
24 25 1 0
20 26 1 1
19 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
12 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.57Molecular Weight (Monoisotopic): 457.2047AlogP: 2.52#Rotatable Bonds: 7Polar Surface Area: 96.97Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.38CX Basic pKa: 0.35CX LogP: 2.06CX LogD: 2.06Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -0.59