disodium mono(1-hydroxy-2-(5-phenyl-1H-1,2,3-triazol-1-yl)ethane-1,1-diyldiphosphonate)

ID: ALA4783284

PubChem CID: 162666496

Max Phase: Preclinical

Molecular Formula: C10H11N3Na2O7P2

Molecular Weight: 349.18

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=P([O-])(O)C(O)(Cn1nncc1-c1ccccc1)P(=O)([O-])O.[Na+].[Na+]

Standard InChI:  InChI=1S/C10H13N3O7P2.2Na/c14-10(21(15,16)17,22(18,19)20)7-13-9(6-11-12-13)8-4-2-1-3-5-8;;/h1-6,14H,7H2,(H2,15,16,17)(H2,18,19,20);;/q;2*+1/p-2

Standard InChI Key:  KKODLZJOEMOGNY-UHFFFAOYSA-L

Molfile:  

     RDKit          2D

 24 23  0  0  0  0  0  0  0  0999 V2000
    8.8373  -11.8330    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
   13.2205  -11.1206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5080  -11.5372    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   13.2250  -11.9459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0830  -11.5331    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   10.2711  -11.2374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8038  -10.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7997  -11.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5204   -9.8909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9913  -10.3955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0789  -12.3580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5038  -12.3622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2081  -12.0831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2679  -10.2290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8231   -9.6186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4142   -8.9020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6064   -9.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9943   -8.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1693   -7.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5582   -7.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7721   -7.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6004   -8.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2127   -8.7735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3330  -12.0496    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  6  5  1  0
  7  8  1  0
  7  9  1  0
  8  5  1  0
  8  3  1  0
  8 10  1  0
  5 11  2  0
  3 12  2  0
  5 13  1  0
  9 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17  9  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 17 18  1  0
M  CHG  4   1   1   2  -1   6  -1  24   1
M  END

Associated Targets(Human)

GGPS1 Tchem Geranylgeranyl pyrophosphate synthetase (715 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 349.18Molecular Weight (Monoisotopic): 349.0229AlogP: -0.05#Rotatable Bonds: 5
Polar Surface Area: 166.00Molecular Species: ACIDHBA: 6HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 0.86CX Basic pKa: 0.30CX LogP: -1.94CX LogD: -6.20
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.46Np Likeness Score: -0.70

References

1. Legigan T,Migianu-Griffoni E,Redouane MA,Descamps A,Deschamp J,Gager O,Monteil M,Barbault F,Lecouvey M.  (2021)  Synthesis and preliminary anticancer evaluation of new triazole bisphosphonate-based isoprenoid biosynthesis inhibitors.,  214  [PMID:33571830] [10.1016/j.ejmech.2021.113241]

Source