The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
disodium mono(1-hydroxy-2-(5-phenyl-1H-1,2,3-triazol-1-yl)ethane-1,1-diyldiphosphonate) ID: ALA4783284
PubChem CID: 162666496
Max Phase: Preclinical
Molecular Formula: C10H11N3Na2O7P2
Molecular Weight: 349.18
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=P([O-])(O)C(O)(Cn1nncc1-c1ccccc1)P(=O)([O-])O.[Na+].[Na+]
Standard InChI: InChI=1S/C10H13N3O7P2.2Na/c14-10(21(15,16)17,22(18,19)20)7-13-9(6-11-12-13)8-4-2-1-3-5-8;;/h1-6,14H,7H2,(H2,15,16,17)(H2,18,19,20);;/q;2*+1/p-2
Standard InChI Key: KKODLZJOEMOGNY-UHFFFAOYSA-L
Molfile:
RDKit 2D
24 23 0 0 0 0 0 0 0 0999 V2000
8.8373 -11.8330 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
13.2205 -11.1206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5080 -11.5372 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
13.2250 -11.9459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0830 -11.5331 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
10.2711 -11.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8038 -10.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7997 -11.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5204 -9.8909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9913 -10.3955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0789 -12.3580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5038 -12.3622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2081 -12.0831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2679 -10.2290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8231 -9.6186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4142 -8.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6064 -9.0696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9943 -8.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1693 -7.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5582 -7.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7721 -7.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6004 -8.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2127 -8.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3330 -12.0496 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
3 2 1 0
4 3 1 0
6 5 1 0
7 8 1 0
7 9 1 0
8 5 1 0
8 3 1 0
8 10 1 0
5 11 2 0
3 12 2 0
5 13 1 0
9 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 9 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
17 18 1 0
M CHG 4 1 1 2 -1 6 -1 24 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 349.18Molecular Weight (Monoisotopic): 349.0229AlogP: -0.05#Rotatable Bonds: 5Polar Surface Area: 166.00Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 0.86CX Basic pKa: 0.30CX LogP: -1.94CX LogD: -6.20Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.46Np Likeness Score: -0.70
References 1. Legigan T,Migianu-Griffoni E,Redouane MA,Descamps A,Deschamp J,Gager O,Monteil M,Barbault F,Lecouvey M. (2021) Synthesis and preliminary anticancer evaluation of new triazole bisphosphonate-based isoprenoid biosynthesis inhibitors., 214 [PMID:33571830 ] [10.1016/j.ejmech.2021.113241 ]