NA

ID: ALA4783329

PubChem CID: 162665600

Max Phase: Preclinical

Molecular Formula: C34H42N2O5

Molecular Weight: 558.72

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c3cc1Oc1c(OC)c(OC)cc4c1C(CCCCOc1ccc(cc1)CC3N(C)CC2)N(C)CC4

Standard InChI:  InChI=1S/C34H42N2O5/c1-35-16-14-24-20-31(38-4)33(39-5)34-32(24)27(35)8-6-7-17-40-25-11-9-22(10-12-25)18-28-26-21-30(41-34)29(37-3)19-23(26)13-15-36(28)2/h9-12,19-21,27-28H,6-8,13-18H2,1-5H3

Standard InChI Key:  TUDBXAHSTMDBFR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
   10.0725  -11.4914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2344  -12.7290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2305  -13.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2312  -14.3892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7811  -13.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6578  -10.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9423  -12.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2225  -10.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7925  -11.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2296  -11.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5180  -11.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3555  -13.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9522  -13.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0834  -11.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2340  -11.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2293  -15.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9497  -13.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7969  -12.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0834  -12.7606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0682  -10.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5066  -10.6561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7986  -11.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8569  -13.1598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5153  -13.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5163  -12.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4981  -13.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5106  -11.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6606  -11.5158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9443  -11.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7724  -13.9035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1889  -14.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8180  -15.2587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2338  -15.9229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0184  -15.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3853  -15.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9674  -14.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4362  -16.5595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8327  -14.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8398  -15.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1573  -15.5690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1558  -16.5523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4 17  1  0
 19 12  1  0
 15 27  1  0
 26 24  1  0
  2 15  2  0
  7 29  1  0
 11 25  2  0
  2 13  1  0
 27  9  2  0
  7 23  1  0
  1 20  1  0
 17 13  1  0
  2 26  1  0
 23 18  1  0
 24  4  1  0
  9  1  1  0
 21  8  1  0
 28  6  1  0
 14 22  1  0
 29 10  2  0
 19  5  1  0
  3  7  2  0
 27 21  1  0
 29 28  1  0
 25  3  1  0
 11 22  1  0
 18 26  2  0
  4 16  1  0
  5 25  1  0
 10 11  1  0
 14 19  1  0
  9 18  1  0
  5 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 34 37  1  0
 24 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4783329

    ---

Associated Targets(Human)

HepaRG (129 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CCRF-CEM (65223 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 558.72Molecular Weight (Monoisotopic): 558.3094AlogP: 6.37#Rotatable Bonds: 3
Polar Surface Area: 52.63Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 8.34CX LogP: 5.79CX LogD: 4.44
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.37Np Likeness Score: 1.47

References

1. Schütz R,Müller M,Geisslinger F,Vollmar A,Bartel K,Bracher F.  (2020)  Synthesis, biological evaluation and toxicity of novel tetrandrine analogues.,  207  [PMID:32942071] [10.1016/j.ejmech.2020.112810]
2. Schütz R,Müller M,Geisslinger F,Vollmar A,Bartel K,Bracher F.  (2020)  Synthesis, biological evaluation and toxicity of novel tetrandrine analogues.,  207  [PMID:32942071] [10.1016/j.ejmech.2020.112810]

Source