(2S,4R)-1-[(2S)-3,3-dimethyl-2-[(2-phenylacetyl)amino]butanoyl]-4-hydroxy-N-[[4-(4-methylthiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide

ID: ALA4783485

PubChem CID: 122529112

Max Phase: Preclinical

Molecular Formula: C30H36N4O4S

Molecular Weight: 548.71

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)Cc2ccccc2)C(C)(C)C)cc1

Standard InChI:  InChI=1S/C30H36N4O4S/c1-19-26(39-18-32-19)22-12-10-21(11-13-22)16-31-28(37)24-15-23(35)17-34(24)29(38)27(30(2,3)4)33-25(36)14-20-8-6-5-7-9-20/h5-13,18,23-24,27,35H,14-17H2,1-4H3,(H,31,37)(H,33,36)/t23-,24+,27-/m1/s1

Standard InChI Key:  GAUPKVQHAPDXDP-ONBPZOJHSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   28.4314  -15.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1500  -14.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8686  -15.0164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1500  -13.7748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5820  -14.6022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2975  -15.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0109  -14.5986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2996  -15.8379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5799  -13.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2934  -13.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8645  -13.3665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5746  -12.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7637  -14.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3142  -14.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8998  -13.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0933  -13.7736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9388  -15.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3281  -16.2889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7245  -15.9855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3351  -15.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1208  -15.6821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2924  -16.4869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0773  -16.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6888  -16.1835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5102  -15.3737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7255  -15.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4755  -16.4331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7349  -17.2162    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   38.5599  -17.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8103  -16.4253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.1401  -15.9444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2334  -12.8454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.1352  -15.1194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7180  -14.6022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7244  -13.7785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0119  -13.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2954  -13.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2959  -14.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0092  -15.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  5  9  1  1
  9 10  1  0
  9 11  1  0
  9 12  1  0
  7 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16  7  1  0
 13 17  1  1
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 27  2  0
 24 27  1  0
 15 32  1  6
 31 33  1  0
  1 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4783485

    ---

Associated Targets(Human)

VHL Tchem Von Hippel-Lindau disease tumor suppressor (136 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 548.71Molecular Weight (Monoisotopic): 548.2457AlogP: 3.47#Rotatable Bonds: 8
Polar Surface Area: 111.63Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.55CX Basic pKa: 2.65CX LogP: 2.50CX LogD: 2.50
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.40Np Likeness Score: -0.62

References

1. Klein VG,Townsend CE,Testa A,Zengerle M,Maniaci C,Hughes SJ,Chan KH,Ciulli A,Lokey RS.  (2020)  Understanding and Improving the Membrane Permeability of VH032-Based PROTACs.,  11  (9): [PMID:32939229] [10.1021/acsmedchemlett.0c00265]

Source