The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4783642
PubChem CID: 147044955
Max Phase: Preclinical
Molecular Formula: C20H23N9O11P2
Molecular Weight: 627.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1ncn2[C@H]1C[C@@H]2OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(O)ncnc54)C[C@@H]3OP(=O)(O)OC[C@H]2O1
Standard InChI: InChI=1S/C20H23N9O11P2/c21-17-15-18(23-5-22-17)28(7-26-15)13-1-9-11(37-13)3-35-42(33,34)40-10-2-14(38-12(10)4-36-41(31,32)39-9)29-8-27-16-19(29)24-6-25-20(16)30/h5-14H,1-4H2,(H,31,32)(H,33,34)(H2,21,22,23)(H,24,25,30)/t9-,10-,11+,12+,13+,14+/m0/s1
Standard InChI Key: BAEJKTUPWJXHEZ-PRSXHHODSA-N
Molfile:
RDKit 2D
46 52 0 0 0 0 0 0 0 0999 V2000
38.7299 -12.5633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1385 -11.3045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4797 -11.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2506 -13.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4334 -13.2229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1798 -13.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8404 -14.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5020 -14.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8014 -11.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5453 -12.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0871 -13.1677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.8853 -13.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1387 -12.2233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.5951 -11.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8394 -15.2982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4023 -14.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2314 -15.0505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4539 -15.3020 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
35.2829 -16.1011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8473 -14.7544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5466 -15.7077 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
38.5456 -16.5249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2548 -15.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0307 -15.8774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.8484 -10.8427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8201 -16.6670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0581 -16.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1018 -17.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8915 -17.9888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3356 -17.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3043 -17.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8356 -16.1098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4673 -18.2932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7447 -19.4035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5072 -19.1097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2297 -18.7690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6740 -18.0874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3058 -17.3639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4936 -17.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0508 -18.0072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4215 -18.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9782 -19.4144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5961 -13.4176 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
36.7365 -18.0071 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
36.6333 -16.6657 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
38.6267 -14.6888 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 10 1 0
9 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
4 1 1 1
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
7 15 1 0
6 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
15 21 1 0
21 22 1 0
21 23 2 0
18 24 1 0
21 32 1 0
14 25 1 0
26 24 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
30 31 1 0
31 32 1 0
28 33 1 1
33 37 1 0
36 34 1 0
34 35 2 0
35 33 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
41 42 1 0
6 43 1 6
30 44 1 6
26 45 1 1
7 46 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 627.40Molecular Weight (Monoisotopic): 627.0992AlogP: 0.55#Rotatable Bonds: 2Polar Surface Area: 263.43Molecular Species: ACIDHBA: 18HBD: 4#RO5 Violations: 2HBA (Lipinski): 20HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.56CX Basic pKa: 4.94CX LogP: -2.42CX LogD: -5.06Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.22Np Likeness Score: 0.39
References 1. Lioux T,Mauny MA,Lamoureux A,Bascoul N,Hays M,Vernejoul F,Baudru AS,Boularan C,Lopes-Vicente J,Qushair G,Tiraby G. (2016) Design, Synthesis, and Biological Evaluation of Novel Cyclic Adenosine-Inosine Monophosphate (cAIMP) Analogs That Activate Stimulator of Interferon Genes (STING)., 59 (22.0): [PMID:27783523 ] [10.1021/acs.jmedchem.6b01300 ]