Cis-rac-3-chloro-N-((1S,3R)-3-(5-(1,4-dimethyl-1H-imidazol-5-yl)-4H-1,2,4-triazol-3-yl)cyclohexyl)-N-methylbenzamide

ID: ALA4783686

PubChem CID: 134194773

Max Phase: Preclinical

Molecular Formula: C21H25ClN6O

Molecular Weight: 412.93

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ncn(C)c1-c1nnc([C@@H]2CCC[C@H](N(C)C(=O)c3cccc(Cl)c3)C2)[nH]1

Standard InChI:  InChI=1S/C21H25ClN6O/c1-13-18(27(2)12-23-13)20-24-19(25-26-20)14-6-5-9-17(11-14)28(3)21(29)15-7-4-8-16(22)10-15/h4,7-8,10,12,14,17H,5-6,9,11H2,1-3H3,(H,24,25,26)/t14-,17+/m1/s1

Standard InChI Key:  KLHYDNVEAJQGOW-PBHICJAKSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   12.7045   -7.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7045   -8.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4165   -9.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1286   -8.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1286   -7.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4165   -7.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8435   -9.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9286  -10.0546    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7353  -10.2274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1488   -9.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5976   -8.8996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9701   -9.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5214  -10.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2755   -9.7034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1904   -8.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3837   -8.7102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3487  -10.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9906   -9.2346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2755   -8.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5616   -9.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2743   -7.9981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9918  -10.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8491   -8.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1357   -9.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1365  -10.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8565  -10.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5670  -10.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8607  -11.2998    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.0459   -7.9488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  1  0
  4  7  1  1
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 10 12  1  0
 13 17  1  0
  2 18  1  1
 18 19  1  0
 19 20  1  0
 19 21  2  0
 18 22  1  0
 20 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 20  1  0
 26 28  1  0
 16 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4783686

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.93Molecular Weight (Monoisotopic): 412.1778AlogP: 3.97#Rotatable Bonds: 4
Polar Surface Area: 79.70Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.96CX Basic pKa: 5.08CX LogP: 2.32CX LogD: 2.30
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: -1.10

References

1.  (2019)  Cyclohexyl benzamide compounds, 
2.  (2019)  Cyclohexyl benzamide compounds, 

Source