The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-(6-aminopyridin-3-yl)-2,6-difluorobenzamido)-N-(4-fluorophenyl)-1H-pyrazole-3-carboxamide ID: ALA4783702
PubChem CID: 162666530
Max Phase: Preclinical
Molecular Formula: C22H15F3N6O2
Molecular Weight: 452.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccc(-c2ccc(F)c(C(=O)Nc3c[nH]nc3C(=O)Nc3ccc(F)cc3)c2F)cn1
Standard InChI: InChI=1S/C22H15F3N6O2/c23-12-2-4-13(5-3-12)29-22(33)20-16(10-28-31-20)30-21(32)18-15(24)7-6-14(19(18)25)11-1-8-17(26)27-9-11/h1-10H,(H2,26,27)(H,28,31)(H,29,33)(H,30,32)
Standard InChI Key: MAYMJSVYAVGKEU-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.6677 -21.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6665 -22.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3746 -22.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0843 -22.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0814 -21.6849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3728 -21.2797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7926 -22.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7939 -23.7323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4997 -22.5054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2080 -22.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2928 -23.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0925 -23.8922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5000 -23.1838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9521 -22.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1195 -21.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8959 -21.5226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5105 -21.2327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7876 -21.2737 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.6778 -20.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4536 -20.1822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6211 -19.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0118 -18.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2322 -19.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0683 -19.8946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9604 -22.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2527 -22.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5452 -22.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5441 -23.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2565 -24.1400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9611 -23.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1781 -18.0373 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.3744 -23.7342 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.8366 -24.1399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
14 15 1 0
15 16 2 0
15 17 1 0
5 18 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
2 25 1 0
22 31 1 0
3 32 1 0
28 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.40Molecular Weight (Monoisotopic): 452.1209AlogP: 3.98#Rotatable Bonds: 5Polar Surface Area: 125.79Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.29CX Basic pKa: 6.17CX LogP: 3.47CX LogD: 3.44Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -1.31
References 1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B. (2021) Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors., 215 [PMID:33611192 ] [10.1016/j.ejmech.2021.113281 ]