The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl (R)-4-(6-chloro-4((5-cyclopropyl-1H-pyrazol-3-yl)amino)quinazoline-2-carbonyl)-2-methylpiperazine-1-carboxylate ID: ALA4783877
PubChem CID: 149714689
Max Phase: Preclinical
Molecular Formula: C23H26ClN7O3
Molecular Weight: 483.96
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)N1CCN(C(=O)c2nc(Nc3cc(C4CC4)[nH]n3)c3cc(Cl)ccc3n2)C[C@H]1C
Standard InChI: InChI=1S/C23H26ClN7O3/c1-3-34-23(33)31-9-8-30(12-13(31)2)22(32)21-25-17-7-6-15(24)10-16(17)20(27-21)26-19-11-18(28-29-19)14-4-5-14/h6-7,10-11,13-14H,3-5,8-9,12H2,1-2H3,(H2,25,26,27,28,29)/t13-/m1/s1
Standard InChI Key: AVWQQPHRUJWUSO-CYBMUJFWSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
3.4324 -13.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4313 -14.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1393 -14.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1375 -13.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8462 -13.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8469 -14.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5555 -14.8712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2637 -14.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2590 -13.6382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5499 -13.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7246 -13.2403 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.5455 -12.4177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2511 -12.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9965 -12.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5401 -11.7232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1277 -11.0177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3294 -11.1919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3501 -11.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0138 -12.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0949 -11.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9730 -14.8662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9762 -15.6834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6791 -14.4549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3857 -14.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0897 -14.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0907 -13.6391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3816 -13.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6714 -13.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7974 -14.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8005 -13.2276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5082 -13.6362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8004 -12.4105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2159 -13.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9237 -13.6360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 11 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 13 2 0
19 18 1 0
20 19 1 0
18 20 1 0
15 18 1 0
8 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
25 29 1 6
30 31 1 0
30 32 2 0
26 30 1 0
31 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.96Molecular Weight (Monoisotopic): 483.1786AlogP: 3.93#Rotatable Bonds: 5Polar Surface Area: 116.34Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.18CX Basic pKa: 2.97CX LogP: 3.87CX LogD: 3.87Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -1.56
References 1. Guo J,Wang T,Wu T,Zhang K,Yin W,Zhu M,Pang Y,Hao C,He Z,Cheng M,Liu Y,Zheng J,Gu J,Zhao D. (2020) Synthesis, bioconversion, pharmacokinetic and pharmacodynamic evaluation of N-isopropyl-oxy-carbonyloxymethyl prodrugs of CZh-226, a potent and selective PAK4 inhibitor., 186 [PMID:31757524 ] [10.1016/j.ejmech.2019.111878 ]