Ethyl (R)-4-(6-chloro-4((5-cyclopropyl-1H-pyrazol-3-yl)amino)quinazoline-2-carbonyl)-2-methylpiperazine-1-carboxylate

ID: ALA4783877

PubChem CID: 149714689

Max Phase: Preclinical

Molecular Formula: C23H26ClN7O3

Molecular Weight: 483.96

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)N1CCN(C(=O)c2nc(Nc3cc(C4CC4)[nH]n3)c3cc(Cl)ccc3n2)C[C@H]1C

Standard InChI:  InChI=1S/C23H26ClN7O3/c1-3-34-23(33)31-9-8-30(12-13(31)2)22(32)21-25-17-7-6-15(24)10-16(17)20(27-21)26-19-11-18(28-29-19)14-4-5-14/h6-7,10-11,13-14H,3-5,8-9,12H2,1-2H3,(H2,25,26,27,28,29)/t13-/m1/s1

Standard InChI Key:  AVWQQPHRUJWUSO-CYBMUJFWSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    3.4324  -13.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4313  -14.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1393  -14.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1375  -13.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8462  -13.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8469  -14.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5555  -14.8712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2637  -14.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2590  -13.6382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5499  -13.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7246  -13.2403    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.5455  -12.4177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2511  -12.0054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9965  -12.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5401  -11.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1277  -11.0177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3294  -11.1919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3501  -11.8014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0138  -12.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0949  -11.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9730  -14.8662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9762  -15.6834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6791  -14.4549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3857  -14.8645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0897  -14.4567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0907  -13.6391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3816  -13.2311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6714  -13.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7974  -14.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8005  -13.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5082  -13.6362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8004  -12.4105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2159  -13.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9237  -13.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 13  2  0
 19 18  1  0
 20 19  1  0
 18 20  1  0
 15 18  1  0
  8 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 25 29  1  6
 30 31  1  0
 30 32  2  0
 26 30  1  0
 31 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4783877

    ---

Associated Targets(Human)

PAK4 Tchem Serine/threonine-protein kinase PAK 4 (3212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.96Molecular Weight (Monoisotopic): 483.1786AlogP: 3.93#Rotatable Bonds: 5
Polar Surface Area: 116.34Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.18CX Basic pKa: 2.97CX LogP: 3.87CX LogD: 3.87
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -1.56

References

1. Guo J,Wang T,Wu T,Zhang K,Yin W,Zhu M,Pang Y,Hao C,He Z,Cheng M,Liu Y,Zheng J,Gu J,Zhao D.  (2020)  Synthesis, bioconversion, pharmacokinetic and pharmacodynamic evaluation of N-isopropyl-oxy-carbonyloxymethyl prodrugs of CZh-226, a potent and selective PAK4 inhibitor.,  186  [PMID:31757524] [10.1016/j.ejmech.2019.111878]

Source