N-cyclopentyl-2-[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoyl]benzamide

ID: ALA4783931

PubChem CID: 146660784

Max Phase: Preclinical

Molecular Formula: C20H23N3O5S

Molecular Weight: 417.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CNS(=O)(=O)c1ccccc1C(=O)NC1CCCC1)Nc1ccc(O)cc1

Standard InChI:  InChI=1S/C20H23N3O5S/c24-16-11-9-15(10-12-16)22-19(25)13-21-29(27,28)18-8-4-3-7-17(18)20(26)23-14-5-1-2-6-14/h3-4,7-12,14,21,24H,1-2,5-6,13H2,(H,22,25)(H,23,26)

Standard InChI Key:  ZIZDHSBANFCYLM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    5.9618  -24.5325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4330  -23.8553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6095  -23.7849    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.4694  -24.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4682  -25.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1830  -25.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8994  -25.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8966  -24.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1812  -23.7910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1787  -22.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8919  -22.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4630  -22.5556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6064  -22.9599    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3192  -22.5447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0353  -22.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0384  -23.7795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7482  -22.5394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4642  -22.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4627  -23.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1778  -24.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8918  -23.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8859  -22.9368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1702  -22.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6083  -24.1748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4606  -21.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1270  -21.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8697  -20.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0447  -20.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7922  -21.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  1  3  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8  3  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 12 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4783931

    ---

Associated Targets(Human)

Hepatocyte (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 417.49Molecular Weight (Monoisotopic): 417.1358AlogP: 1.98#Rotatable Bonds: 7
Polar Surface Area: 124.60Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 1.84CX LogD: 1.83
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.51Np Likeness Score: -1.49

References

1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG.  (2020)  A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis.,  202  [PMID:32629335] [10.1016/j.ejmech.2020.112600]

Source