The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2'-Deoxyzebularine 3',5'-Bis[4-chlorophenyl(ethoxy-L-alaninyl)]phosphate ID: ALA478399
PubChem CID: 25155848
Max Phase: Preclinical
Molecular Formula: C31H38Cl2N4O12P2
Molecular Weight: 791.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cccnc2=O)C[C@@H]1OP(=O)(N[C@@H](C)C(=O)OCC)Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1
Standard InChI: InChI=1S/C31H38Cl2N4O12P2/c1-5-43-29(38)20(3)35-50(41,47-24-12-8-22(32)9-13-24)45-19-27-26(18-28(46-27)37-17-7-16-34-31(37)40)49-51(42,36-21(4)30(39)44-6-2)48-25-14-10-23(33)11-15-25/h7-17,20-21,26-28H,5-6,18-19H2,1-4H3,(H,35,41)(H,36,42)/t20-,21-,26-,27+,28+,50?,51?/m0/s1
Standard InChI Key: QOIYQCFJSVGDRR-HDHIHZQVSA-N
Molfile:
RDKit 2D
51 54 0 0 0 0 0 0 0 0999 V2000
13.0086 -9.0139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1836 -9.0170 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
11.3552 -8.9800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1667 -9.8419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2048 -8.1923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7442 -9.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9222 -10.3379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3121 -10.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5255 -10.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3524 -9.8295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9639 -9.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8726 -10.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8558 -11.0937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5953 -9.8710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5604 -11.5208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1318 -11.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2835 -11.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9139 -11.1942 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.9891 -11.5515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4935 -8.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3185 -8.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5735 -7.5617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9060 -7.0767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2386 -7.5617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3581 -7.3069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9708 -7.8662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7526 -7.6143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9285 -6.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3160 -6.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5277 -6.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7955 -8.6724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4540 -7.3069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2825 -6.4999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4978 -6.2449 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
10.6977 -6.0272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7337 -5.4543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2663 -7.0368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1120 -6.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3190 -6.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7337 -6.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9439 -7.7676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7447 -7.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3266 -7.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5362 -5.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7721 -4.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1030 -5.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5736 -4.2812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2041 -3.8726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1408 -4.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3590 -8.3495 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.9433 -4.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22 25 1 1
25 26 1 0
1 2 1 0
12 13 1 0
6 7 2 0
12 14 1 1
2 4 1 0
25 30 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
7 8 1 0
26 31 2 0
13 15 1 0
24 32 1 1
13 16 2 0
32 33 1 0
33 34 1 0
15 17 1 0
34 35 1 0
8 9 2 0
34 36 1 0
9 18 1 0
34 37 2 0
2 5 2 0
35 38 1 0
17 19 1 0
38 39 2 0
20 21 1 0
39 40 1 0
9 10 1 0
40 41 2 0
2 3 1 0
41 42 1 0
10 11 2 0
42 43 2 0
43 38 1 0
11 6 1 0
36 44 1 0
3 6 1 0
44 45 1 0
21 22 1 0
44 46 1 6
22 23 1 0
23 24 1 0
45 47 1 0
45 48 2 0
24 20 1 0
47 49 1 0
20 1 1 6
41 50 1 0
4 12 1 0
49 51 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 791.52Molecular Weight (Monoisotopic): 790.1339AlogP: 5.70#Rotatable Bonds: 18Polar Surface Area: 191.84Molecular Species: NEUTRALHBA: 14HBD: 2#RO5 Violations: 3HBA (Lipinski): 16HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.94CX Basic pKa: ┄CX LogP: 4.12CX LogD: 4.12Aromatic Rings: 3Heavy Atoms: 51QED Weighted: 0.12Np Likeness Score: -0.11
References 1. Yoo CB, Valente R, Congiatu C, Gavazza F, Angel A, Siddiqui MA, Jones PA, McGuigan C, Marquez VE.. (2008) Activation of p16 gene silenced by DNA methylation in cancer cells by phosphoramidate derivatives of 2'-deoxyzebularine., 51 (23): [PMID:19006382 ] [10.1021/jm8005965 ]