(Z)-5-(2-Ethyl-2-(2-oxo-6-(8-(trifluoromethyl)naphthalen-2-yl)-1,2-dihydropyridin-3-yl)butylidene)oxazolidine-2,4-dione

ID: ALA4784048

PubChem CID: 137487319

Max Phase: Preclinical

Molecular Formula: C25H21F3N2O4

Molecular Weight: 470.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(/C=C1\OC(=O)NC1=O)(CC)c1ccc(-c2ccc3cccc(C(F)(F)F)c3c2)[nH]c1=O

Standard InChI:  InChI=1S/C25H21F3N2O4/c1-3-24(4-2,13-20-22(32)30-23(33)34-20)18-10-11-19(29-21(18)31)15-9-8-14-6-5-7-17(16(14)12-15)25(26,27)28/h5-13H,3-4H2,1-2H3,(H,29,31)(H,30,32,33)/b20-13-

Standard InChI Key:  RUJZKJQVXZHAGH-MOSHPQCFSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    4.3047  -10.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7174   -9.9920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8462  -10.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4314  -10.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4314  -11.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1367  -11.6223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8420  -11.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8420  -10.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1367   -9.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7243  -11.6274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5473  -11.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5448  -12.4447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2510  -12.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2520  -11.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9589  -11.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9576  -12.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6667  -12.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3774  -12.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3747  -11.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6651  -11.2158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7150   -9.1742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0046   -8.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9095   -7.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1091   -7.7954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7051   -8.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2560   -9.1094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8930   -8.5967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5116   -7.4075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1037   -9.7692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4875  -10.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6627  -10.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3693   -9.9880    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.9539   -9.9920    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.6577   -9.5793    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  9  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  2  1  0
  5 10  2  0
 11 12  2  0
 12 13  1  0
 13 16  2  0
 15 14  2  0
 14 11  1  0
  7 11  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  2 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 22  1  0
 25 27  2  0
 23 28  2  0
  3 29  1  0
  1 30  1  0
 20 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4784048

    ---

Associated Targets(Human)

PTGER3 Tclin Prostanoid EP3 receptor (1985 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.45Molecular Weight (Monoisotopic): 470.1453AlogP: 5.42#Rotatable Bonds: 5
Polar Surface Area: 88.26Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.15CX Basic pKa: CX LogP: 4.34CX LogD: 3.14
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -0.45

References

1. Zhang X,Zhu B,Guo L,Bakaj I,Rankin M,Ho G,Kauffman J,Lee SP,Norquay L,Macielag MJ.  (2021)  Discovery of a Novel Series of Pyridone-Based EP3 Antagonists for the Treatment of Type 2 Diabetes.,  12  (3): [PMID:33738072] [10.1021/acsmedchemlett.0c00667]

Source