(E)-N-(tert-butyl)-2-(4-chlorobenzoyl)-4-(4-fluorobenzylidene)-1-propyl-5-oxopyrrolidine-2-carboxamide

ID: ALA4784135

PubChem CID: 162666328

Max Phase: Preclinical

Molecular Formula: C27H30ClFN2O3

Molecular Weight: 485.00

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCN1C(=O)/C(=C/c2ccc(F)cc2)CC1(C(=O)NC(C)(C)C)C(=O)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C27H30ClFN2O3/c1-5-6-15-31-24(33)20(16-18-7-13-22(29)14-8-18)17-27(31,25(34)30-26(2,3)4)23(32)19-9-11-21(28)12-10-19/h7-14,16H,5-6,15,17H2,1-4H3,(H,30,34)/b20-16+

Standard InChI Key:  KGNKQSDISCOOOT-CAPFRKAQSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    6.9666   -6.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6396   -8.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4632   -8.1532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8743   -7.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4628   -6.7283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6359   -6.7311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2286   -7.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8744   -6.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6999   -6.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1853   -6.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9687   -5.5962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1832   -5.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9264   -4.5580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2270   -8.8671    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.6796   -5.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6727   -4.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3842   -3.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3774   -3.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7921   -6.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9625   -7.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2454   -7.6550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6752   -7.6623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2413   -8.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5243   -8.8896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9541   -8.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2370   -9.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2048   -5.7055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5049   -6.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5012   -7.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2133   -8.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9282   -7.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9265   -6.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2139   -6.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6431   -8.0722    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  2  0
  9 10  1  0
 10  1  1  0
  1 11  1  0
 11 12  1  0
 12  9  1  0
 12 13  2  0
  2 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  1 19  1  0
  1 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
 19 27  2  0
 19 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4784135

    ---

Associated Targets(Human)

Ca-Ski (420 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.00Molecular Weight (Monoisotopic): 484.1929AlogP: 5.43#Rotatable Bonds: 7
Polar Surface Area: 66.48Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.54CX LogD: 5.54
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -0.67

References

1. Zhu XL,Tian XQ,Xu HH,Wang HM,Chen QH,Zeng XH.  (2020)  Rhopaladins' analogue (E)-2-aroyl-4-(4-fluorobenzylidene)-5-oxopyrrolidines inhibit proliferation, promote apoptosis and down-regulation of E6/E7 mRNA in cervical cancer.,  30  (23): [PMID:32950616] [10.1016/j.bmcl.2020.127554]

Source