The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(tert-butyl)-2-(4-chlorobenzoyl)-4-(4-fluorobenzylidene)-1-propyl-5-oxopyrrolidine-2-carboxamide ID: ALA4784135
PubChem CID: 162666328
Max Phase: Preclinical
Molecular Formula: C27H30ClFN2O3
Molecular Weight: 485.00
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCN1C(=O)/C(=C/c2ccc(F)cc2)CC1(C(=O)NC(C)(C)C)C(=O)c1ccc(Cl)cc1
Standard InChI: InChI=1S/C27H30ClFN2O3/c1-5-6-15-31-24(33)20(16-18-7-13-22(29)14-8-18)17-27(31,25(34)30-26(2,3)4)23(32)19-9-11-21(28)12-10-19/h7-14,16H,5-6,15,17H2,1-4H3,(H,30,34)/b20-16+
Standard InChI Key: KGNKQSDISCOOOT-CAPFRKAQSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
6.9666 -6.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6396 -8.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4632 -8.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8743 -7.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4628 -6.7283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6359 -6.7311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2286 -7.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8744 -6.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6999 -6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1853 -6.6781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9687 -5.5962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1832 -5.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9264 -4.5580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2270 -8.8671 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.6796 -5.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6727 -4.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3842 -3.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3774 -3.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7921 -6.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9625 -7.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2454 -7.6550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6752 -7.6623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2413 -8.4805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5243 -8.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9541 -8.8969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2370 -9.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2048 -5.7055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5049 -6.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5012 -7.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2133 -8.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9282 -7.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9265 -6.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2139 -6.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6431 -8.0722 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 2 0
9 10 1 0
10 1 1 0
1 11 1 0
11 12 1 0
12 9 1 0
12 13 2 0
2 14 1 0
11 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
1 19 1 0
1 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
23 25 1 0
23 26 1 0
19 27 2 0
19 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.00Molecular Weight (Monoisotopic): 484.1929AlogP: 5.43#Rotatable Bonds: 7Polar Surface Area: 66.48Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.54CX LogD: 5.54Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -0.67
References 1. Zhu XL,Tian XQ,Xu HH,Wang HM,Chen QH,Zeng XH. (2020) Rhopaladins' analogue (E)-2-aroyl-4-(4-fluorobenzylidene)-5-oxopyrrolidines inhibit proliferation, promote apoptosis and down-regulation of E6/E7 mRNA in cervical cancer., 30 (23): [PMID:32950616 ] [10.1016/j.bmcl.2020.127554 ]