The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Butyl ((5-isobutyl-3-(3-(2-(2-butyl-1H-imidazol-1-yl)acetyl)phenyl)thiophen-2-yl)sulfonyl)carbamate ID: ALA4784233
PubChem CID: 162666037
Max Phase: Preclinical
Molecular Formula: C28H37N3O5S2
Molecular Weight: 559.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1cccc(C(=O)Cn2ccnc2CCCC)c1
Standard InChI: InChI=1S/C28H37N3O5S2/c1-5-7-12-26-29-13-14-31(26)19-25(32)22-11-9-10-21(17-22)24-18-23(16-20(3)4)37-27(24)38(34,35)30-28(33)36-15-8-6-2/h9-11,13-14,17-18,20H,5-8,12,15-16,19H2,1-4H3,(H,30,33)
Standard InChI Key: BKSLRIMAAJIWRY-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
8.8488 -7.5693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4443 -8.2792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.2613 -8.2746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8096 -9.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4955 -9.0951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0791 -9.1788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8580 -10.3605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6760 -8.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4237 -7.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6065 -7.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3536 -8.0212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0154 -8.5033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.5756 -8.2735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4455 -9.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0801 -9.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6808 -9.3720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9058 -6.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5737 -5.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0562 -5.1790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8701 -5.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2022 -6.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7201 -6.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6399 -4.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0429 -3.7651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8252 -4.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5581 -3.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3406 -2.9778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0217 -2.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6574 -3.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3734 -3.8006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1759 -10.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4454 -10.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7633 -10.8914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0328 -10.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0441 -4.4097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3459 -5.1775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8318 -5.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1336 -6.5906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 6 2 0
4 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
8 12 1 0
13 14 1 0
14 15 1 0
14 16 1 0
11 13 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
23 24 2 0
23 25 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
26 30 1 0
25 30 1 0
19 23 1 0
9 17 1 0
2 8 1 0
5 2 1 0
31 32 1 0
32 33 1 0
33 34 1 0
7 31 1 0
26 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 559.75Molecular Weight (Monoisotopic): 559.2175AlogP: 6.25#Rotatable Bonds: 14Polar Surface Area: 107.36Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.61CX Basic pKa: 7.14CX LogP: 5.32CX LogD: 5.87Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: -0.91
References 1. Wannberg J,Gising J,Lindman J,Salander J,Gutiérrez-de-Terán H,Ablahad H,Hamid S,Grönbladh A,Spizzo I,Gaspari TA,Widdop RE,Hallberg A,Backlund M,Leśniak A,Hallberg M,Larhed M. (2021) N-(Methyloxycarbonyl)thiophene sulfonamides as high affinity AT2 receptor ligands., 29 [PMID:33309749 ] [10.1016/j.bmc.2020.115859 ]