The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-cyano-4-(2-methoxyethoxy)pyridin-2-yl)-7-formyl-6-((N-methylacetamido)methyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxamide ID: ALA4784243
PubChem CID: 118036192
Max Phase: Preclinical
Molecular Formula: C23H26N6O5
Molecular Weight: 466.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCCOc1cc(NC(=O)N2CCCc3cc(CN(C)C(C)=O)c(C=O)nc32)ncc1C#N
Standard InChI: InChI=1S/C23H26N6O5/c1-15(31)28(2)13-17-9-16-5-4-6-29(22(16)26-19(17)14-30)23(32)27-21-10-20(34-8-7-33-3)18(11-24)12-25-21/h9-10,12,14H,4-8,13H2,1-3H3,(H,25,27,32)
Standard InChI Key: LKLLFMPSJSCSDN-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
14.4356 -8.1925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4345 -9.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1425 -9.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1407 -7.7837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8494 -8.1889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8501 -9.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5587 -9.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2669 -9.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2622 -8.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5531 -7.7787 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7278 -7.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7276 -6.9669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5487 -6.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2543 -6.5492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8389 -6.5567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8345 -5.7395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5414 -5.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5374 -4.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8270 -4.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1191 -4.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1266 -5.3422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8219 -3.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8165 -2.4781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7277 -9.4217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0205 -9.0104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3115 -9.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0231 -8.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6051 -9.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3089 -10.2339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2431 -4.1040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9528 -4.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6585 -4.0972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3682 -4.5024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0739 -4.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
1 11 1 0
11 12 2 0
10 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
22 23 3 0
19 22 1 0
24 25 1 0
2 24 1 0
25 26 1 0
25 27 1 0
26 28 1 0
26 29 2 0
18 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.50Molecular Weight (Monoisotopic): 466.1965AlogP: 2.15#Rotatable Bonds: 8Polar Surface Area: 137.75Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.87CX Basic pKa: 2.20CX LogP: 1.43CX LogD: 1.43Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.40
References 1. Fairhurst RA,Knoepfel T,Buschmann N,Leblanc C,Mah R,Todorov M,Nimsgern P,Ripoche S,Niklaus M,Warin N,Luu VH,Madoerin M,Wirth J,Graus-Porta D,Weiss A,Kiffe M,Wartmann M,Kinyamu-Akunda J,Sterker D,Stamm C,Adler F,Buhles A,Schadt H,Couttet P,Blank J,Galuba I,Trappe J,Voshol J,Ostermann N,Zou C,Berghausen J,Del Rio Espinola A,Jahnke W,Furet P. (2020) Discovery of Roblitinib (FGF401) as a Reversible-Covalent Inhibitor of the Kinase Activity of Fibroblast Growth Factor Receptor 4., 63 (21.0): [PMID:32930584 ] [10.1021/acs.jmedchem.0c01019 ]