The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(azetidine-1-carbonyl)-N-(2-(difluoromethoxy)benzyl)-N-(2-(methylamino)-2-oxoethyl)-1H-imidazole-4-carboxamide ID: ALA4784347
PubChem CID: 162665762
Max Phase: Preclinical
Molecular Formula: C21H25F2N5O4
Molecular Weight: 449.46
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)CN(Cc1ccccc1OC(F)F)C(=O)c1c[nH]c(C(=O)N2CCCCC2)n1
Standard InChI: InChI=1S/C21H25F2N5O4/c1-24-17(29)13-28(12-14-7-3-4-8-16(14)32-21(22)23)19(30)15-11-25-18(26-15)20(31)27-9-5-2-6-10-27/h3-4,7-8,11,21H,2,5-6,9-10,12-13H2,1H3,(H,24,29)(H,25,26)
Standard InChI Key: JNGJOWHBKZQNCQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
14.9201 -14.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5773 -15.0523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2435 -14.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9968 -13.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1805 -13.7934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1405 -14.8119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5384 -14.2594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9632 -15.6096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4815 -13.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2963 -13.2338 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7804 -12.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4566 -11.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6438 -11.7363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1547 -12.3942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9438 -11.1730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6212 -13.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4331 -14.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7539 -14.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5649 -14.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0526 -14.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7236 -13.5107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9135 -13.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2654 -15.4815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5885 -16.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0918 -16.8748 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.4001 -16.3275 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.6191 -10.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7181 -13.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1199 -12.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3388 -13.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1593 -13.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7609 -14.5107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
1 6 1 0
6 7 1 0
6 8 2 0
4 9 1 0
9 10 1 0
9 14 2 0
10 11 1 0
11 12 1 0
12 13 2 0
12 15 1 0
10 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
18 23 1 0
23 24 1 0
24 25 1 0
24 26 1 0
15 27 1 0
7 28 1 0
7 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.46Molecular Weight (Monoisotopic): 449.1875AlogP: 2.03#Rotatable Bonds: 8Polar Surface Area: 107.63Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.98CX Basic pKa: 0.04CX LogP: 1.45CX LogD: 1.45Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: -1.73
References 1. Veerman JJN,Bruseker YB,Damen E,Heijne EH,van Bruggen W,Hekking KFW,Winkel R,Hupp CD,Keefe AD,Liu J,Thomson HA,Zhang Y,Cuozzo JW,McRiner AJ,Mulvihill MJ,van Rijnsbergen P,Zech B,Renzetti LM,Babiss L,Müller G. (2021) Discovery of 2,4-1H-Imidazole Carboxamides as Potent and Selective TAK1 Inhibitors., 12 (4.0): [PMID:33859795 ] [10.1021/acsmedchemlett.0c00547 ]