(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)-4-phenylbutanamide

ID: ALA4784390

PubChem CID: 162666123

Max Phase: Preclinical

Molecular Formula: C31H36N4O7

Molecular Weight: 576.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)NO

Standard InChI:  InChI=1S/C31H36N4O7/c1-21(36)32-28(20-42-19-24-10-6-3-7-11-24)30(39)33-26(17-14-22-8-4-2-5-9-22)29(38)34-27(31(40)35-41)18-23-12-15-25(37)16-13-23/h2-13,15-16,26-28,37,41H,14,17-20H2,1H3,(H,32,36)(H,33,39)(H,34,38)(H,35,40)/t26-,27-,28+/m1/s1

Standard InChI Key:  MESRLOCFVUHCCL-FCEKVYKBSA-N

Molfile:  

 
     RDKit          2D

 42 44  0  0  0  0  0  0  0  0999 V2000
   32.5151  -17.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2297  -16.7055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8007  -16.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5151  -17.9430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9442  -17.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6587  -16.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3732  -17.1181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6587  -15.8805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.0878  -16.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8022  -17.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0878  -15.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8022  -17.9430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5168  -16.7055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.2313  -17.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9458  -16.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2313  -17.9430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9458  -18.3556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6604  -17.1181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.3750  -16.7055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.9458  -15.8805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.9420  -19.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6558  -19.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3712  -19.1817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3686  -18.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6543  -17.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9442  -17.9430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6587  -18.3556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6587  -19.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3732  -19.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3709  -20.4194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0846  -20.8319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8000  -20.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7974  -19.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0832  -19.1812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8022  -15.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8022  -14.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5188  -14.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5191  -13.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8041  -12.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0872  -13.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0904  -14.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0863  -19.5933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 10 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  1  0
 15 18  1  0
 18 19  1  0
 15 20  2  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
  5 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 23 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4784390

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 576.65Molecular Weight (Monoisotopic): 576.2584AlogP: 1.76#Rotatable Bonds: 15
Polar Surface Area: 166.09Molecular Species: NEUTRALHBA: 7HBD: 6
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 8.65CX Basic pKa: CX LogP: 2.13CX LogD: 2.11
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.12Np Likeness Score: 0.07

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source