The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)-4-phenylbutanamide ID: ALA4784390
PubChem CID: 162666123
Max Phase: Preclinical
Molecular Formula: C31H36N4O7
Molecular Weight: 576.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)NO
Standard InChI: InChI=1S/C31H36N4O7/c1-21(36)32-28(20-42-19-24-10-6-3-7-11-24)30(39)33-26(17-14-22-8-4-2-5-9-22)29(38)34-27(31(40)35-41)18-23-12-15-25(37)16-13-23/h2-13,15-16,26-28,37,41H,14,17-20H2,1H3,(H,32,36)(H,33,39)(H,34,38)(H,35,40)/t26-,27-,28+/m1/s1
Standard InChI Key: MESRLOCFVUHCCL-FCEKVYKBSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
32.5151 -17.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2297 -16.7055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8007 -16.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5151 -17.9430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9442 -17.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6587 -16.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3732 -17.1181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6587 -15.8805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0878 -16.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8022 -17.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0878 -15.8805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8022 -17.9430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5168 -16.7055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2313 -17.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9458 -16.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2313 -17.9430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9458 -18.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6604 -17.1181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.3750 -16.7055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9458 -15.8805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9420 -19.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6558 -19.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3712 -19.1817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3686 -18.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6543 -17.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9442 -17.9430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6587 -18.3556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6587 -19.1807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3732 -19.5933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3709 -20.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0846 -20.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8000 -20.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7974 -19.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0832 -19.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8022 -15.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8022 -14.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5188 -14.2317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5191 -13.4073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8041 -12.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0872 -13.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0904 -14.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0863 -19.5933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
9 11 1 6
10 12 2 0
10 13 1 0
13 14 1 0
14 15 1 0
14 16 1 1
16 17 1 0
15 18 1 0
18 19 1 0
15 20 2 0
17 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 17 1 0
5 26 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
11 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
23 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 576.65Molecular Weight (Monoisotopic): 576.2584AlogP: 1.76#Rotatable Bonds: 15Polar Surface Area: 166.09Molecular Species: NEUTRALHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.65CX Basic pKa: ┄CX LogP: 2.13CX LogD: 2.11Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.12Np Likeness Score: 0.07
References 1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M. (2020) Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease., 63 (21): [PMID:33107733 ] [10.1021/acs.jmedchem.0c01285 ]