N-(3-methoxyphenyl)-2-(5-nitrofuran-2-yl)-1H-benzo[d]imidazole-5-carboxamide

ID: ALA4784450

PubChem CID: 135391757

Max Phase: Preclinical

Molecular Formula: C19H14N4O5

Molecular Weight: 378.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(NC(=O)c2ccc3[nH]c(-c4ccc([N+](=O)[O-])o4)nc3c2)c1

Standard InChI:  InChI=1S/C19H14N4O5/c1-27-13-4-2-3-12(10-13)20-19(24)11-5-6-14-15(9-11)22-18(21-14)16-7-8-17(28-16)23(25)26/h2-10H,1H3,(H,20,24)(H,21,22)

Standard InChI Key:  HYVXSQWQLZOONH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    6.6228  -15.1149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6216  -15.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3364  -16.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3346  -14.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0499  -15.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0547  -15.9376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8421  -16.1884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3240  -15.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8343  -14.8514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1500  -15.5112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6389  -16.1757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4219  -15.9161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4170  -15.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6310  -14.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0953  -16.3993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8469  -16.0593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0140  -17.2201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9069  -16.3540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1929  -15.9411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9063  -17.1790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4782  -16.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7649  -15.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0506  -16.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0495  -17.1747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7686  -17.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4799  -17.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3368  -15.9355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3379  -15.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  8 10  1  0
 15 16  2  0
 15 17  1  0
 12 15  1  0
  2 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 23 27  1  0
 27 28  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA4784450

    ---

Associated Targets(non-human)

Hemozoin (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.34Molecular Weight (Monoisotopic): 378.0964AlogP: 3.99#Rotatable Bonds: 5
Polar Surface Area: 123.29Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.15CX Basic pKa: 2.72CX LogP: 3.31CX LogD: 3.30
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.40Np Likeness Score: -1.81

References

1. Sharma, Mousmee, Prasher, Parteek.  (2020)  An epigrammatic status of the azole-based antimalarial drugs,  11  (2): [PMID:33479627] [10.1039/c9md00479c]

Source