(O-(Hydroxy(((R)-1-(oleoyloxy)-3-(prop-2-yn-1-yloxy)propan-2-yl)oxy)-phosphoryl)-L-serine)

ID: ALA4784581

PubChem CID: 162666591

Max Phase: Preclinical

Molecular Formula: C27H48NO9P

Molecular Weight: 561.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCOC[C@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)OP(=O)(O)OC[C@H](N)C(=O)O

Standard InChI:  InChI=1S/C27H48NO9P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(29)35-22-24(21-34-20-4-2)37-38(32,33)36-23-25(28)27(30)31/h2,11-12,24-25H,3,5-10,13-23,28H2,1H3,(H,30,31)(H,32,33)/b12-11-/t24-,25+/m1/s1

Standard InChI Key:  AOYCQVPRMOKATB-MMHKTWFYSA-N

Molfile:  

 
     RDKit          2D

 38 37  0  0  0  0  0  0  0  0999 V2000
    6.7425  -26.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7416  -27.7823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4438  -26.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1672  -26.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8705  -26.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5941  -26.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2973  -26.4720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0209  -26.8659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7241  -26.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4476  -26.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0246  -26.5511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4683  -27.6588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7644  -28.0892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0398  -27.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3358  -28.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6113  -27.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9074  -28.1610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1827  -27.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4788  -28.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4995  -29.0216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4626  -24.5927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8793  -25.3094    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    4.2917  -24.5901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7376  -25.7260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4521  -25.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0230  -25.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3085  -25.7260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0230  -24.4885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7376  -26.5511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1666  -25.7260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5956  -25.7260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3101  -25.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0246  -25.7260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3101  -24.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0246  -24.0759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7391  -24.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4535  -24.0759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1628  -23.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  1 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 22 21  2  0
 23 22  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 26 28  2  0
 24 29  1  6
 25 30  1  0
 30 22  1  0
 22 31  1  0
 31 32  1  0
 32 33  1  0
 33 11  1  0
 32 34  1  6
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4784581

    ---

Associated Targets(non-human)

Gpr34 G protein-coupled receptor 34 (411 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
P2ry10 Putative P2Y purinoceptor 10 (276 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 561.65Molecular Weight (Monoisotopic): 561.3067AlogP: 5.13#Rotatable Bonds: 26
Polar Surface Area: 154.61Molecular Species: ZWITTERIONHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.43CX Basic pKa: 9.38CX LogP: 3.97CX LogD: 0.99
Aromatic Rings: Heavy Atoms: 38QED Weighted: 0.04Np Likeness Score: 0.67

References

1. Nakamura S,Sayama M,Uwamizu A,Jung S,Ikubo M,Otani Y,Kano K,Omi J,Inoue A,Aoki J,Ohwada T.  (2020)  Non-naturally Occurring Regio Isomer of Lysophosphatidylserine Exhibits Potent Agonistic Activity toward G Protein-Coupled Receptors.,  63  (17): [PMID:32787112] [10.1021/acs.jmedchem.0c01126]

Source