The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Lestaurtinib ID: ALA4784666
PubChem CID: 162666043
Max Phase: Preclinical
Molecular Formula: C28H25N3O3
Molecular Weight: 451.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@]1(C)CC[C@H]2O[C@]1(C)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4
Standard InChI: InChI=1S/C28H25N3O3/c1-27(33-3)13-12-20-30-18-10-6-4-8-15(18)22-23-17(14-29-26(23)32)21-16-9-5-7-11-19(16)31(25(21)24(22)30)28(27,2)34-20/h4-11,20H,12-14H2,1-3H3,(H,29,32)/t20-,27-,28+/m1/s1
Standard InChI Key: GLYKNMXTUIMIIR-NFTQTCPJSA-N
Molfile:
RDKit 2D
34 41 0 0 0 0 0 0 0 0999 V2000
12.2804 -11.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6951 -10.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2811 -9.9493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4592 -9.9493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0453 -10.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4539 -11.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8975 -11.9859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1482 -11.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2365 -10.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5766 -10.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8212 -10.6725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7269 -11.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3886 -11.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1110 -12.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8286 -12.3728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5419 -12.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8368 -11.9909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5895 -11.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5033 -10.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1700 -10.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9235 -10.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0065 -11.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3394 -11.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5419 -13.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8286 -14.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1110 -13.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3980 -14.0196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6850 -13.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1110 -14.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2859 -12.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2117 -9.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8790 -8.6759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5347 -9.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3321 -8.9315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
8 7 1 0
9 8 2 0
5 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
14 7 1 1
14 15 1 0
16 15 1 0
16 17 1 1
1 17 1 0
17 18 1 0
18 19 2 0
2 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
18 23 1 0
16 24 1 0
24 25 1 0
25 26 1 0
26 14 1 0
26 27 1 1
27 28 1 0
26 29 1 0
14 30 1 0
4 31 1 0
31 32 1 0
33 32 1 0
3 33 1 0
33 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.53Molecular Weight (Monoisotopic): 451.1896AlogP: 5.55#Rotatable Bonds: 1Polar Surface Area: 57.42Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.47CX Basic pKa: ┄CX LogP: 4.63CX LogD: 4.63Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: 1.03
References 1. (2020) Compositions and methods for treating beta-globinopathies,