Lestaurtinib

ID: ALA4784666

PubChem CID: 162666043

Max Phase: Preclinical

Molecular Formula: C28H25N3O3

Molecular Weight: 451.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO[C@]1(C)CC[C@H]2O[C@]1(C)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4

Standard InChI:  InChI=1S/C28H25N3O3/c1-27(33-3)13-12-20-30-18-10-6-4-8-15(18)22-23-17(14-29-26(23)32)21-16-9-5-7-11-19(16)31(25(21)24(22)30)28(27,2)34-20/h4-11,20H,12-14H2,1-3H3,(H,29,32)/t20-,27-,28+/m1/s1

Standard InChI Key:  GLYKNMXTUIMIIR-NFTQTCPJSA-N

Molfile:  

 
     RDKit          2D

 34 41  0  0  0  0  0  0  0  0999 V2000
   12.2804  -11.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6951  -10.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2811   -9.9493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4592   -9.9493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0453  -10.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4539  -11.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8975  -11.9859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1482  -11.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2365  -10.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5766  -10.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8212  -10.6725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7269  -11.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3886  -11.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1110  -12.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8286  -12.3728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5419  -12.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8368  -11.9909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5895  -11.6522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5033  -10.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1700  -10.3493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9235  -10.6891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0065  -11.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3394  -11.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5419  -13.6091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8286  -14.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1110  -13.6091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3980  -14.0196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6850  -13.6091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1110  -14.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2859  -12.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2117   -9.1671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8790   -8.6759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5347   -9.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3321   -8.9315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  8  7  1  0
  9  8  2  0
  5  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 14  7  1  1
 14 15  1  0
 16 15  1  0
 16 17  1  1
  1 17  1  0
 17 18  1  0
 18 19  2  0
  2 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 18 23  1  0
 16 24  1  0
 24 25  1  0
 25 26  1  0
 26 14  1  0
 26 27  1  1
 27 28  1  0
 26 29  1  0
 14 30  1  0
  4 31  1  0
 31 32  1  0
 33 32  1  0
  3 33  1  0
 33 34  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4784666

    ---

Associated Targets(Human)

RIOK3 Tchem Serine/threonine-protein kinase RIO3 (317 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.53Molecular Weight (Monoisotopic): 451.1896AlogP: 5.55#Rotatable Bonds: 1
Polar Surface Area: 57.42Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.47CX Basic pKa: CX LogP: 4.63CX LogD: 4.63
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: 1.03

References

1.  (2020)  Compositions and methods for treating beta-globinopathies, 

Source