The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(3-Aminopyrrolidin-1-carbonyl)-1-benzyl-4,11-dihydroxy-2-methyl-1H-naphtho[2,3-f]indole-5,10-dione ID: ALA4784735
PubChem CID: 162665391
Max Phase: Preclinical
Molecular Formula: C29H25N3O5
Molecular Weight: 495.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C(=O)N2CC[C@H](N)C2)c2c(O)c3c(c(O)c2n1Cc1ccccc1)C(=O)c1ccccc1C3=O
Standard InChI: InChI=1S/C29H25N3O5/c1-15-20(29(37)31-12-11-17(30)14-31)21-24(32(15)13-16-7-3-2-4-8-16)28(36)23-22(27(21)35)25(33)18-9-5-6-10-19(18)26(23)34/h2-10,17,35-36H,11-14,30H2,1H3/t17-/m0/s1
Standard InChI Key: MWBSMWQVWBSBIQ-KRWDZBQOSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
38.2539 -11.5149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2527 -12.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9608 -12.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9590 -11.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6676 -11.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6664 -12.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3765 -12.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3789 -11.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0935 -11.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0923 -12.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8016 -12.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8000 -11.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5099 -11.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5103 -12.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2920 -12.5854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.7748 -11.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2914 -11.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3789 -10.2803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3760 -13.5650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.7977 -10.2867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.8029 -13.5615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.5435 -10.4785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3428 -10.3082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.9964 -9.8714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.5919 -11.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9489 -10.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6564 -10.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4861 -9.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6734 -9.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4031 -10.7728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.5448 -13.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3442 -13.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5926 -14.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3912 -14.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9387 -13.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6820 -13.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8841 -12.9241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 14 2 0
13 12 2 0
12 9 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
8 18 2 0
7 19 2 0
12 20 1 0
11 21 1 0
17 22 1 0
22 23 1 0
22 24 2 0
16 25 1 0
23 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 23 1 0
27 30 1 6
15 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.54Molecular Weight (Monoisotopic): 495.1794AlogP: 3.36#Rotatable Bonds: 3Polar Surface Area: 125.86Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.61CX Basic pKa: 9.55CX LogP: 3.38CX LogD: 3.14Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: -0.32
References 1. Tikhomirov AS,Litvinova VA,Andreeva DV,Tsvetkov VB,Dezhenkova LG,Volodina YL,Kaluzhny DN,Treshalin ID,Schols D,Ramonova AA,Moisenovich MM,Shtil AA,Shchekotikhin AE. (2020) Amides of pyrrole- and thiophene-fused anthraquinone derivatives: A role of the heterocyclic core in antitumor properties., 199 [PMID:32428792 ] [10.1016/j.ejmech.2020.112294 ]