The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(11-Oxo-10-pyridin-4-ylmethyl-10,11-dihydro-5-oxa-4,10-diaza-dibenzo[a,d]cyclohepten-7-yl)-3-phenyl-urea ID: ALA4784797
PubChem CID: 162665931
Max Phase: Preclinical
Molecular Formula: C25H19N5O3
Molecular Weight: 437.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccccc1)Nc1ccc2c(c1)Oc1ncccc1C(=O)N2Cc1ccncc1
Standard InChI: InChI=1S/C25H19N5O3/c31-24-20-7-4-12-27-23(20)33-22-15-19(29-25(32)28-18-5-2-1-3-6-18)8-9-21(22)30(24)16-17-10-13-26-14-11-17/h1-15H,16H2,(H2,28,29,32)
Standard InChI Key: ADPBSLWBQNSPIO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
3.5583 -29.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3395 -29.1940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3633 -27.3926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9605 -28.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9621 -27.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6762 -27.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3932 -27.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3915 -28.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6728 -29.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5996 -27.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2302 -28.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4553 -28.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0439 -27.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4134 -26.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1942 -26.9008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0265 -29.6359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5186 -30.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1089 -27.4583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8240 -27.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5397 -27.4593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8235 -28.6979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5386 -29.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3065 -30.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9116 -29.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6989 -29.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8787 -30.7451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2649 -31.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4799 -31.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2506 -28.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9653 -29.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9652 -29.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2445 -30.3468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5328 -29.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 11 1 0
1 2 1 0
5 3 1 0
3 10 1 0
2 4 1 0
4 5 1 0
4 9 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
10 11 1 0
10 15 2 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
1 16 2 0
2 17 1 0
7 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
17 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
22 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 22 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.46Molecular Weight (Monoisotopic): 437.1488AlogP: 5.07#Rotatable Bonds: 4Polar Surface Area: 96.45Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.42CX Basic pKa: 5.02CX LogP: 3.49CX LogD: 3.48Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: -1.50
References 1. Martínez-González S,García AB,Albarrán MI,Cebriá A,Amezquita-Alves A,García-Campos FJ,Martínez-Gago J,Martínez-Torrecuadrada J,Muñoz IG,Blanco-Aparicio C,Pastor J. (2020) Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one derivatives as CDK8 inhibitors., 201 [PMID:32599324 ] [10.1016/j.ejmech.2020.112443 ]