The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-{2-[(1S)-1-Cyclopropylethyl]-1-oxo-7-(trifluoromethyl)-2,3-dihydro-1H-isoindol-5-yl}pyrazolo[1,5-a]pyrimidin-2-yl)acetamide ID: ALA4785086
PubChem CID: 162665297
Max Phase: Preclinical
Molecular Formula: C22H20F3N5O2
Molecular Weight: 443.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cc2nc(-c3cc4c(c(C(F)(F)F)c3)C(=O)N([C@@H](C)C3CC3)C4)ccn2n1
Standard InChI: InChI=1S/C22H20F3N5O2/c1-11(13-3-4-13)29-10-15-7-14(8-16(22(23,24)25)20(15)21(29)32)17-5-6-30-19(27-17)9-18(28-30)26-12(2)31/h5-9,11,13H,3-4,10H2,1-2H3,(H,26,28,31)/t11-/m0/s1
Standard InChI Key: LFDGWINKLUZIEU-NSHDSACASA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
8.4200 -5.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1332 -6.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1331 -6.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8491 -7.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8451 -5.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5616 -6.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5686 -6.8344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3582 -7.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8365 -6.4076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3468 -5.7415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8504 -8.0757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6628 -6.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0841 -7.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0718 -5.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0918 -7.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8002 -7.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4236 -4.7753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7112 -4.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7099 -6.0112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9969 -5.6018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9931 -4.7770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2075 -4.5258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7258 -5.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2137 -5.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9037 -5.1992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4893 -4.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6672 -4.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8970 -3.7752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1392 -8.4880 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.5631 -8.4857 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.8447 -8.8938 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.6215 -7.8640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
1 2 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 6 1 0
4 11 1 0
9 12 1 0
12 13 1 1
12 14 1 0
15 13 1 0
16 15 1 0
13 16 1 0
1 17 1 0
17 18 2 0
18 21 1 0
20 19 1 0
19 1 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 2 0
23 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
11 29 1 0
11 30 1 0
11 31 1 0
8 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.43Molecular Weight (Monoisotopic): 443.1569AlogP: 4.13#Rotatable Bonds: 4Polar Surface Area: 79.60Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.28CX Basic pKa: 0.46CX LogP: 3.64CX LogD: 3.64Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.66Np Likeness Score: -1.09
References 1. Drew SL,Thomas-Tran R,Beatty JW,Fournier J,Lawson KV,Miles DH,Mata G,Sharif EU,Yan X,Mailyan AK,Ginn E,Chen J,Wong K,Soni D,Dhanota P,Chen PY,Shaqfeh SG,Meleza C,Pham AT,Chen A,Zhao X,Banuelos J,Jin L,Schindler U,Walters MJ,Young SW,Walker NP,Leleti MR,Powers JP,Jeffrey JL. (2020) Discovery of Potent and Selective PI3Kγ Inhibitors., 63 (19.0): [PMID:32865410 ] [10.1021/acs.jmedchem.0c01203 ]