N-((5s,8s)-3-benzyl-2-imino-4-oxo-1,3-diazaspiro[4.5]decan-8-yl)-2-(3-chlorophenoxy)-N-methylpropanamide

ID: ALA4785193

PubChem CID: 162666399

Max Phase: Preclinical

Molecular Formula: C25H29ClN4O3

Molecular Weight: 468.99

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(Oc1cccc(Cl)c1)C(=O)N(C)[C@H]1CC[C@]2(CC1)NC(=N)N(Cc1ccccc1)C2=O

Standard InChI:  InChI=1S/C25H29ClN4O3/c1-17(33-21-10-6-9-19(26)15-21)22(31)29(2)20-11-13-25(14-12-20)23(32)30(24(27)28-25)16-18-7-4-3-5-8-18/h3-10,15,17,20H,11-14,16H2,1-2H3,(H2,27,28)/t17?,20-,25+

Standard InChI Key:  QRVWVUYATFZPAW-KNXNPYQDSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   22.1035   -4.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0994   -5.8010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8830   -6.0587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3731   -5.3927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8897   -4.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6814   -4.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6814   -4.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3941   -5.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1067   -4.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3941   -3.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1327   -6.8449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1473   -3.9426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1974   -5.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6102   -6.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1980   -6.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6072   -7.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4327   -7.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8472   -6.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4322   -6.0975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9692   -3.7378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9668   -2.9128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2554   -4.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5390   -3.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2578   -4.9796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8251   -4.1588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5367   -2.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1088   -3.7462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1106   -2.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3952   -2.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6803   -2.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6853   -3.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4014   -4.1645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9771   -4.1749    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  1  0
  6 10  1  0
  7  8  1  0
  8  1  1  0
  1  9  1  0
  9 10  1  0
  3 11  2  0
  5 12  2  0
  4 13  1  0
 13 14  1  0
 14 15  1  0
 14 19  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
  6 20  1  1
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 23 26  1  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4785193

    ---

Associated Targets(Human)

FFAR2 Tchem Free fatty acid receptor 2 (545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.99Molecular Weight (Monoisotopic): 468.1928AlogP: 3.81#Rotatable Bonds: 6
Polar Surface Area: 85.73Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.20CX LogP: 3.89CX LogD: 3.89
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.67Np Likeness Score: -1.21

References

1. Fells JI,Ai X,Weinglass A,Feng W,Lei Y,Finley M,Hoveyda HR,Fraser GL,Machacek M.  (2020)  Identification of free fatty acid receptor 2 agonists using virtual screening.,  30  (21.0): [PMID:32755680] [10.1016/j.bmcl.2020.127460]

Source