The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((5s,8s)-3-benzyl-2-imino-4-oxo-1,3-diazaspiro[4.5]decan-8-yl)-2-(3-chlorophenoxy)-N-methylpropanamide ID: ALA4785193
PubChem CID: 162666399
Max Phase: Preclinical
Molecular Formula: C25H29ClN4O3
Molecular Weight: 468.99
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(Oc1cccc(Cl)c1)C(=O)N(C)[C@H]1CC[C@]2(CC1)NC(=N)N(Cc1ccccc1)C2=O
Standard InChI: InChI=1S/C25H29ClN4O3/c1-17(33-21-10-6-9-19(26)15-21)22(31)29(2)20-11-13-25(14-12-20)23(32)30(24(27)28-25)16-18-7-4-3-5-8-18/h3-10,15,17,20H,11-14,16H2,1-2H3,(H2,27,28)/t17?,20-,25+
Standard InChI Key: QRVWVUYATFZPAW-KNXNPYQDSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
22.1035 -4.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0994 -5.8010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8830 -6.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3731 -5.3927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8897 -4.7262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6814 -4.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6814 -4.9755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3941 -5.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1067 -4.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3941 -3.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1327 -6.8449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1473 -3.9426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1974 -5.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6102 -6.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1980 -6.8184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6072 -7.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4327 -7.5316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8472 -6.8153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4322 -6.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9692 -3.7378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9668 -2.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2554 -4.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5390 -3.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2578 -4.9796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8251 -4.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5367 -2.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1088 -3.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1106 -2.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3952 -2.5138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6803 -2.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6853 -3.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4014 -4.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9771 -4.1749 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 1
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 1 0
6 10 1 0
7 8 1 0
8 1 1 0
1 9 1 0
9 10 1 0
3 11 2 0
5 12 2 0
4 13 1 0
13 14 1 0
14 15 1 0
14 19 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
6 20 1 1
20 21 1 0
20 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
23 26 1 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.99Molecular Weight (Monoisotopic): 468.1928AlogP: 3.81#Rotatable Bonds: 6Polar Surface Area: 85.73Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.20CX LogP: 3.89CX LogD: 3.89Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.67Np Likeness Score: -1.21
References 1. Fells JI,Ai X,Weinglass A,Feng W,Lei Y,Finley M,Hoveyda HR,Fraser GL,Machacek M. (2020) Identification of free fatty acid receptor 2 agonists using virtual screening., 30 (21.0): [PMID:32755680 ] [10.1016/j.bmcl.2020.127460 ]