N-(3-chloro-4-methoxyphenyl)-2-(5-nitrofuran-2-yl)-1H-benzo[d]imidazole-5-carboxamide

ID: ALA4785401

PubChem CID: 135391800

Max Phase: Preclinical

Molecular Formula: C19H13ClN4O5

Molecular Weight: 412.79

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(NC(=O)c2ccc3[nH]c(-c4ccc([N+](=O)[O-])o4)nc3c2)cc1Cl

Standard InChI:  InChI=1S/C19H13ClN4O5/c1-28-15-5-3-11(9-12(15)20)21-19(25)10-2-4-13-14(8-10)23-18(22-13)16-6-7-17(29-16)24(26)27/h2-9H,1H3,(H,21,25)(H,22,23)

Standard InChI Key:  ZDGRLIKUNTWOJB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   33.7352   -8.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7340   -9.3812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4489   -9.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4470   -8.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1624   -8.5503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1672   -9.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9547   -9.6275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4366   -8.9560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9469   -8.2903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2627   -8.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7515   -9.6148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.5346   -9.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5298   -8.5301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7436   -8.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2082   -9.8384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.9599   -9.4985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.1267  -10.6593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0193   -9.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3051   -9.3801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0186  -10.6181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5904   -9.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8769   -9.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1627   -9.7880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1616  -10.6139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8808  -11.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5921  -10.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4488   -9.3746    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   29.4473  -11.0268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7327  -10.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  8 10  1  0
 15 16  2  0
 15 17  1  0
 12 15  1  0
  2 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 23 27  1  0
 24 28  1  0
 28 29  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA4785401

    ---

Associated Targets(non-human)

Hemozoin (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.79Molecular Weight (Monoisotopic): 412.0574AlogP: 4.65#Rotatable Bonds: 5
Polar Surface Area: 123.29Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.15CX Basic pKa: 2.72CX LogP: 3.91CX LogD: 3.91
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.36Np Likeness Score: -1.82

References

1. Sharma, Mousmee, Prasher, Parteek.  (2020)  An epigrammatic status of the azole-based antimalarial drugs,  11  (2): [PMID:33479627] [10.1039/c9md00479c]

Source