7-[3-(3-Methoxy-phenyl)-4,5-dihydro-isoxazol-5-ylmethoxy]-4-methyl-chromen-2-one

ID: ALA4785477

PubChem CID: 162668157

Max Phase: Preclinical

Molecular Formula: C21H19NO5

Molecular Weight: 365.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(C2=NOC(COc3ccc4c(C)cc(=O)oc4c3)C2)c1

Standard InChI:  InChI=1S/C21H19NO5/c1-13-8-21(23)26-20-11-16(6-7-18(13)20)25-12-17-10-19(22-27-17)14-4-3-5-15(9-14)24-2/h3-9,11,17H,10,12H2,1-2H3

Standard InChI Key:  LTSFMVGMKOBXRT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    7.9683   -8.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9671   -9.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6752   -9.9493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6734   -8.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3820   -8.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3827   -9.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0913   -9.9433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7995   -9.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7948   -8.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0857   -8.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0814   -7.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5088   -9.9383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2591   -9.9484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5517   -9.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8437   -9.9472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1008   -9.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5535  -10.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9616  -10.9315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7610  -10.7621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7440  -10.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4130   -9.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6011   -9.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1194   -9.9635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4553  -10.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2662  -10.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2697   -8.5553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7509   -7.8948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
  8 12  2  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 22 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4785477

    ---

Associated Targets(Human)

UACC-903 (393 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 365.39Molecular Weight (Monoisotopic): 365.1263AlogP: 3.68#Rotatable Bonds: 5
Polar Surface Area: 70.26Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.42CX LogP: 3.51CX LogD: 3.51
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.65Np Likeness Score: -0.56

References

1. Lingaraju GS,Balaji KS,Jayarama S,Anil SM,Kiran KR,Sadashiva MP.  (2018)  Synthesis of new coumarin tethered isoxazolines as potential anticancer agents.,  28  (23-24): [PMID:30396758] [10.1016/j.bmcl.2018.10.046]

Source