The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 2-((7S)-7-acetamido-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[6,7]cyclohepta[1,2-f]benzofuran-11-yl)acetate ID: ALA4785493
PubChem CID: 162668166
Max Phase: Preclinical
Molecular Formula: C25H27NO7
Molecular Weight: 453.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)Cc1coc2cc3c(cc12)-c1c(cc(OC)c(OC)c1OC)CC[C@@H]3NC(C)=O
Standard InChI: InChI=1S/C25H27NO7/c1-13(27)26-19-7-6-14-8-21(29-2)24(31-4)25(32-5)23(14)18-10-16-15(9-22(28)30-3)12-33-20(16)11-17(18)19/h8,10-12,19H,6-7,9H2,1-5H3,(H,26,27)/t19-/m0/s1
Standard InChI Key: VREIUAKDCTWCKO-IBGZPJMESA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
25.6466 -5.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5415 -1.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5404 -2.1196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2484 -2.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2466 -0.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9600 -2.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9552 -1.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5962 -0.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4007 -0.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7620 -1.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2487 -3.3457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8323 -2.5276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8337 -0.8916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1249 -2.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1261 -1.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5792 -1.6784 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9956 -2.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8128 -2.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5949 -3.0937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4159 -2.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6132 -2.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3739 -3.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9766 -3.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5412 -3.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7431 -3.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9411 -4.0139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8816 -4.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1792 -4.5173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1881 -5.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2159 -6.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5224 -6.5193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9370 -6.4713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5502 -7.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 6 2 0
7 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
6 21 1 0
8 9 1 0
9 10 1 0
10 20 1 0
4 11 1 0
3 12 1 0
2 13 1 0
12 14 1 0
13 15 1 0
10 16 1 6
16 17 1 0
17 18 1 0
17 19 2 0
20 21 2 0
21 22 1 0
22 26 2 0
25 23 2 0
23 20 1 0
11 24 1 0
25 26 1 0
26 27 1 0
27 1 2 0
1 28 1 0
28 25 1 0
27 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.49Molecular Weight (Monoisotopic): 453.1788AlogP: 3.96#Rotatable Bonds: 6Polar Surface Area: 96.23Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.58CX LogD: 2.58Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: 0.59
References 1. Shchegravina ES,Svirshchevskaya EV,Combes S,Allegro D,Barbier P,Gigant B,Varela PF,Gavryushin AE,Kobanova DA,Shchekotikhin AE,Fedorov AY. (2020) Discovery of dihydrofuranoallocolchicinoids - Highly potent antimitotic agents with low acute toxicity., 207 [PMID:32827941 ] [10.1016/j.ejmech.2020.112724 ]