The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Amino-2-((4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl)(methyl)amino)-N-(4-chlorobenzyl)butanamide ID: ALA4785506
PubChem CID: 162668300
Max Phase: Preclinical
Molecular Formula: C26H32ClN3OS2
Molecular Weight: 502.15
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccsc1C(=CCCN(C)C(CCN)C(=O)NCc1ccc(Cl)cc1)c1sccc1C
Standard InChI: InChI=1S/C26H32ClN3OS2/c1-18-11-15-32-24(18)22(25-19(2)12-16-33-25)5-4-14-30(3)23(10-13-28)26(31)29-17-20-6-8-21(27)9-7-20/h5-9,11-12,15-16,23H,4,10,13-14,17,28H2,1-3H3,(H,29,31)
Standard InChI Key: BSSIARMOAYIHEQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
2.6333 -3.9708 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.4582 -3.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7150 -3.1867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0457 -2.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3807 -3.1867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9423 -4.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7629 -4.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6059 -5.3920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7999 -5.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7128 -6.3786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4661 -6.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0187 -6.1025 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.5000 -2.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1889 -5.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2470 -5.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0676 -5.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -5.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3723 -5.7189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2153 -6.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8565 -6.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7087 -4.9656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5293 -4.8804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2246 -4.2977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5200 -7.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0041 -7.8081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6884 -4.0483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8649 -4.1302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1671 -4.7217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9898 -4.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3314 -3.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8440 -3.2112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0230 -3.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1523 -3.8027 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
2 6 1 0
6 7 2 0
6 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
3 13 1 0
9 14 1 0
7 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 1 0
18 20 1 0
18 21 1 0
21 22 1 0
21 23 2 0
20 24 1 0
24 25 1 0
22 27 1 0
26 27 1 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
30 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.15Molecular Weight (Monoisotopic): 501.1675AlogP: 5.87#Rotatable Bonds: 11Polar Surface Area: 58.36Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.66CX LogP: 5.80CX LogD: 3.44Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: -0.69
References 1. Zaręba P,Gryzło B,Malawska K,Sałat K,Höfner GC,Nowaczyk A,Fijałkowski Ł,Rapacz A,Podkowa A,Furgała A,Żmudzki P,Wanner KT,Malawska B,Kulig K. (2020) Novel mouse GABA uptake inhibitors with enhanced inhibitory activity toward mGAT3/4 and their effect on pain threshold in mice., 188 [PMID:31901745 ] [10.1016/j.ejmech.2019.111920 ]