The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R)-2-allyl-N4-((S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl)-N1-hydroxy-3-isobutylsuccinamide ID: ALA4785595
PubChem CID: 9855374
Max Phase: Preclinical
Molecular Formula: C18H33N3O4
Molecular Weight: 355.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC[C@H](C(=O)NO)[C@@H](CC(C)C)C(=O)N[C@H](C(=O)NC)C(C)(C)C
Standard InChI: InChI=1S/C18H33N3O4/c1-8-9-12(16(23)21-25)13(10-11(2)3)15(22)20-14(17(24)19-7)18(4,5)6/h8,11-14,25H,1,9-10H2,2-7H3,(H,19,24)(H,20,22)(H,21,23)/t12-,13+,14+/m0/s1
Standard InChI Key: DDRBOOUOUSFWET-BFHYXJOUSA-N
Molfile:
RDKit 2D
25 24 0 0 0 0 0 0 0 0999 V2000
10.3625 -9.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0770 -8.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6481 -8.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9336 -9.2459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2191 -8.8334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6481 -8.0083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3625 -10.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6481 -10.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6481 -11.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7915 -9.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0758 -8.0088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7970 -7.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5087 -8.0164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8027 -6.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7915 -10.0709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5059 -8.8334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2205 -9.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9350 -8.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9350 -8.0083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2212 -10.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8798 -10.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6535 -9.2415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3651 -8.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4846 -10.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2168 -10.8918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
3 4 1 0
4 5 1 0
3 6 2 0
1 7 1 6
7 8 1 0
8 9 2 0
2 10 1 0
2 11 1 1
11 12 1 0
12 13 1 0
12 14 1 0
10 15 2 0
10 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
17 20 1 6
20 21 1 0
18 22 1 0
22 23 1 0
20 24 1 0
20 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 355.48Molecular Weight (Monoisotopic): 355.2471AlogP: 1.62#Rotatable Bonds: 9Polar Surface Area: 107.53Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.86CX Basic pKa: 0.13CX LogP: 1.78CX LogD: 1.77Aromatic Rings: ┄Heavy Atoms: 25QED Weighted: 0.29Np Likeness Score: 0.55