The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-([(2S,5R)-5-(6-Amino-purin-9-yl)-3,4-dihydroxy-tetrahydro-furan-2-ylmethyl]-{2-[(2R,5S)-2-(6-amino-purin-9-yl)-4-hydroxy-5-hydroxymethyl-tetrahydro-furan-3-yloxy]-ethyl}-amino)-pentanoic acid ID: ALA4785987
PubChem CID: 162668095
Max Phase: Preclinical
Molecular Formula: C26H35N11O9
Molecular Weight: 645.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1ncn2[C@@H]1O[C@H](CN(CCCC(=O)O)CCO[C@@H]2[C@H](O)[C@@H](CO)O[C@H]2n2cnc3c(N)ncnc32)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C26H35N11O9/c27-21-15-23(31-8-29-21)36(10-33-15)25-19(43)17(41)12(45-25)6-35(3-1-2-14(39)40)4-5-44-20-18(42)13(7-38)46-26(20)37-11-34-16-22(28)30-9-32-24(16)37/h8-13,17-20,25-26,38,41-43H,1-7H2,(H,39,40)(H2,27,29,31)(H2,28,30,32)/t12-,13-,17-,18-,19-,20-,25-,26-/m1/s1
Standard InChI Key: NRQUMMDGMXTXIB-DQSURDJZSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
9.0592 -9.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8764 -9.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1308 -8.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4678 -8.1430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8091 -8.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0318 -8.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8615 -7.5737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5780 -10.0624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3560 -10.0635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1688 -9.9791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6484 -10.6407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4612 -10.5563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9407 -11.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6075 -11.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8119 -12.1361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7256 -12.9487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4718 -13.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0192 -12.6752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2040 -11.5899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0174 -13.3565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6408 -14.0815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9083 -8.3737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5711 -8.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2329 -8.3722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0986 -14.6881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5065 -15.3962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1642 -7.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9791 -7.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3879 -6.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9829 -6.1876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1649 -6.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7598 -6.8913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2050 -6.8971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3922 -14.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3040 -15.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9595 -15.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7034 -15.3734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7879 -14.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1316 -14.0859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8718 -16.5146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7944 -9.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6072 -9.7256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9405 -8.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7533 -8.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2340 -9.5558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0877 -8.1479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
5 6 1 1
6 7 1 0
1 8 1 6
2 9 1 6
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
14 13 1 1
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
15 19 1 6
16 20 1 6
17 21 1 1
3 22 1 1
22 23 1 0
23 24 2 0
24 28 1 0
27 22 1 0
21 25 1 0
25 26 2 0
26 35 1 0
34 21 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
29 33 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
36 40 1 0
12 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
44 46 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 645.63Molecular Weight (Monoisotopic): 645.2619AlogP: -2.75#Rotatable Bonds: 13Polar Surface Area: 288.39Molecular Species: ACIDHBA: 19HBD: 7#RO5 Violations: 3HBA (Lipinski): 20HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.89CX Basic pKa: 8.39CX LogP: -5.73CX LogD: -5.76Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.08Np Likeness Score: 0.58
References 1. Ahmed-Belkacem R,Sutto-Ortiz P,Guiraud M,Canard B,Vasseur JJ,Decroly E,Debart F. (2020) Synthesis of adenine dinucleosides SAM analogs as specific inhibitors of SARS-CoV nsp14 RNA cap guanine-N7-methyltransferase., 201 [PMID:32563813 ] [10.1016/j.ejmech.2020.112557 ]