(R)-4-(5-(3-Chloro-4-((1-(2-fluorophenyl)ethyl)amino)quinolin-6-yl)pyrimidin-2-yl)thiomorpholine-1,1-dioxide

ID: ALA4785988

PubChem CID: 126531397

Max Phase: Preclinical

Molecular Formula: C25H23ClFN5O2S

Molecular Weight: 512.01

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H](Nc1c(Cl)cnc2ccc(-c3cnc(N4CCS(=O)(=O)CC4)nc3)cc12)c1ccccc1F

Standard InChI:  InChI=1S/C25H23ClFN5O2S/c1-16(19-4-2-3-5-22(19)27)31-24-20-12-17(6-7-23(20)28-15-21(24)26)18-13-29-25(30-14-18)32-8-10-35(33,34)11-9-32/h2-7,12-16H,8-11H2,1H3,(H,28,31)/t16-/m1/s1

Standard InChI Key:  WPAUVOWBCWKNRC-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    9.9903   -9.1340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9903   -9.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2853  -10.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5762   -9.9512    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.5762   -9.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2853   -8.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2972  -10.7185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7737   -9.8064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6994   -8.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6994   -7.9041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4085   -7.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1134   -7.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1134   -8.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4085   -9.1340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9457   -6.2697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6548   -6.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6548   -7.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9457   -7.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2366   -7.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5316   -7.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8225   -7.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8225   -6.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5316   -6.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2366   -6.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9457   -8.7254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6548   -9.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3638   -8.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6548   -9.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9457  -10.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9457  -11.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6548  -11.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3638  -11.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3638  -10.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2366   -9.9512    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.3638   -7.9041    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  4  7  2  0
  4  8  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 15 24  1  0
 19 24  1  0
 26 27  1  6
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 28 33  2  0
 29 34  1  0
 26 28  1  0
 25 26  1  0
 18 25  1  0
 17 35  1  0
 12 21  1  0
  1  9  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4785988

    ---

Associated Targets(Human)

TNF Tclin TNF-alpha (1897 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.01Molecular Weight (Monoisotopic): 511.1245AlogP: 4.89#Rotatable Bonds: 5
Polar Surface Area: 88.08Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.22CX LogP: 3.66CX LogD: 3.64
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.64

References

1. Xiao HY,Li N,Duan JJ,Jiang B,Lu Z,Ngu K,Tino J,Kopcho LM,Lu H,Chen J,Tebben AJ,Sheriff S,Chang CY,Yanchunas J,Calambur D,Gao M,Shuster DJ,Susulic V,Xie JH,Guarino VR,Wu DR,Gregor KR,Goldstine CB,Hynes J,Macor JE,Salter-Cid L,Burke JR,Shaw PJ,Dhar TGM.  (2020)  Biologic-like In Vivo Efficacy with Small Molecule Inhibitors of TNFα Identified Using Scaffold Hopping and Structure-Based Drug Design Approaches.,  63  (23): [PMID:33261314] [10.1021/acs.jmedchem.0c01732]

Source