1-tert-butyl-3-(6-fluoro-1H-indol-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine

ID: ALA4785996

PubChem CID: 162668188

Max Phase: Preclinical

Molecular Formula: C17H17FN6

Molecular Weight: 324.36

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)n1nc(-c2c[nH]c3cc(F)ccc23)c2c(N)ncnc21

Standard InChI:  InChI=1S/C17H17FN6/c1-17(2,3)24-16-13(15(19)21-8-22-16)14(23-24)11-7-20-12-6-9(18)4-5-10(11)12/h4-8,20H,1-3H3,(H2,19,21,22)

Standard InChI Key:  QPPKPLGSQXAGHG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
    4.0650  -14.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2441  -14.2636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6404  -14.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4048  -11.7869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1703  -12.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7367  -13.1741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2013  -11.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2187  -13.4442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8717  -12.9414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5939  -12.1648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7693  -12.1902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5399  -12.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4317  -10.8076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5493  -14.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9635  -11.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1729  -10.1195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5906  -10.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9008  -10.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7714  -11.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4065  -11.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1714  -11.5251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2974  -10.7130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6611  -10.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0595  -10.4181    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6 12  2  0
 11  7  2  0
  7  4  1  0
 11 12  1  0
  9 10  2  0
  8  9  1  0
 10 11  1  0
 12  8  1  0
  7 13  1  0
  8  2  1  0
  2 14  1  0
 10 15  1  0
 15 19  1  0
 18 16  1  0
 16 17  1  0
 17 15  2  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 22 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4785996

    ---

Associated Targets(Human)

PRKD2 Tchem Serine/threonine-protein kinase D2 (2847 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 324.36Molecular Weight (Monoisotopic): 324.1499AlogP: 3.45#Rotatable Bonds: 1
Polar Surface Area: 85.41Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.80CX Basic pKa: 3.68CX LogP: 2.96CX LogD: 2.96
Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.56Np Likeness Score: -0.95

References

1. Gilles P,Kashyap RS,Freitas MJ,Ceusters S,Van Asch K,Janssens A,De Jonghe S,Persoons L,Cobbaut M,Daelemans D,Van Lint J,Voet ARD,De Borggraeve WM.  (2020)  Design, synthesis and biological evaluation of pyrazolo[3,4-d]pyrimidine-based protein kinase D inhibitors.,  205  [PMID:32835918] [10.1016/j.ejmech.2020.112638]

Source