The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-(((S)-1-((2S,4R)-4-hydroxy-2-((4-(4-methylthiazol-5-yl)benzyl)carbamoyl)pyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl)amino)-11-oxoundecanoic acid ID: ALA4786107
PubChem CID: 134184031
Max Phase: Preclinical
Molecular Formula: C33H48N4O6S
Molecular Weight: 628.84
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCCCCCCCCC(=O)O)C(C)(C)C)cc1
Standard InChI: InChI=1S/C33H48N4O6S/c1-22-29(44-21-35-22)24-16-14-23(15-17-24)19-34-31(42)26-18-25(38)20-37(26)32(43)30(33(2,3)4)36-27(39)12-10-8-6-5-7-9-11-13-28(40)41/h14-17,21,25-26,30,38H,5-13,18-20H2,1-4H3,(H,34,42)(H,36,39)(H,40,41)/t25-,26+,30-/m1/s1
Standard InChI Key: MTQZLQCVZFDQOZ-DIIXFEDBSA-N
Molfile:
RDKit 2D
44 46 0 0 0 0 0 0 0 0999 V2000
21.8071 -20.0066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1036 -19.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3894 -19.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6825 -19.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9683 -19.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2647 -19.5530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5505 -19.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8436 -19.5319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1287 -19.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4259 -19.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7076 -19.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5254 -19.6074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7998 -20.8274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6962 -20.7349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0047 -19.4946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3086 -18.2576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0162 -18.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7304 -18.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6181 -18.6948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2803 -17.4384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5963 -16.9816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8171 -16.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6369 -16.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9236 -16.9295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8283 -17.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1946 -16.7407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6892 -18.0737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3337 -15.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7040 -15.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9394 -15.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3082 -15.1686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4473 -14.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2169 -14.0768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8431 -14.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0194 -14.0385 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.5889 -13.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1117 -12.7153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8701 -13.0189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8121 -13.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5651 -12.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0938 -15.4768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4326 -18.6925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7412 -17.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4942 -17.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
1 12 2 0
1 13 1 0
11 14 2 0
16 17 1 0
17 18 1 0
16 19 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
20 24 1 0
25 26 1 0
25 27 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
29 34 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
35 39 1 0
38 40 1 0
32 39 1 0
26 28 1 0
21 25 1 6
23 41 1 1
16 20 1 0
17 15 1 6
11 15 1 0
18 42 1 0
18 43 1 0
18 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.84Molecular Weight (Monoisotopic): 628.3295AlogP: 4.82#Rotatable Bonds: 16Polar Surface Area: 148.93Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.95CX Basic pKa: 2.65CX LogP: 3.61CX LogD: 1.19Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.19Np Likeness Score: -0.30
References 1. Sun N,Ren C,Kong Y,Zhong H,Chen J,Li Y,Zhang J,Zhou Y,Qiu X,Lin H,Song X,Yang X,Jiang B. (2020) Development of a Brigatinib degrader (SIAIS117) as a potential treatment for ALK positive cancer resistance., 193 [PMID:32179332 ] [10.1016/j.ejmech.2020.112190 ]