2-Chloro-9-((6-(2,2-difluoroethoxy)pyridin-2-yl)methyl)-9H-purin-6-amine

ID: ALA4786234

PubChem CID: 162667896

Max Phase: Preclinical

Molecular Formula: C13H11ClF2N6O

Molecular Weight: 340.72

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc(Cl)nc2c1ncn2Cc1cccc(OCC(F)F)n1

Standard InChI:  InChI=1S/C13H11ClF2N6O/c14-13-20-11(17)10-12(21-13)22(6-18-10)4-7-2-1-3-9(19-7)23-5-8(15)16/h1-3,6,8H,4-5H2,(H2,17,20,21)

Standard InChI Key:  JIMSQILLWCPUDF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   11.6708   -5.7503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1582   -6.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6855   -7.0725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9040   -6.8314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2020   -7.2481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4900   -6.8477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4800   -6.0306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1819   -5.6139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8939   -6.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1719   -4.7968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9454   -7.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7466   -8.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2880   -7.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0893   -7.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3491   -8.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8078   -8.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0065   -8.7832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0718   -9.7170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8730   -9.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1329  -10.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9239  -10.8543    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.5605  -11.2390    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7840   -7.2644    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  1  9  1  0
  4  9  1  0
  8 10  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 19 20  1  0
 18 19  1  0
 20 21  1  0
 20 22  1  0
 16 18  1  0
 11 12  1  0
  3 11  1  0
  6 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4786234

    ---

Associated Targets(Human)

PDE8A Tclin Phosphodiesterase 8A (260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 340.72Molecular Weight (Monoisotopic): 340.0651AlogP: 2.15#Rotatable Bonds: 5
Polar Surface Area: 91.74Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.73CX LogP: 2.09CX LogD: 2.09
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.72Np Likeness Score: -1.41

References

1. Huang Y,Wu XN,Zhou Q,Wu Y,Zheng D,Li Z,Guo L,Luo HB.  (2020)  Rational Design of 2-Chloroadenine Derivatives as Highly Selective Phosphodiesterase 8A Inhibitors.,  63  (24): [PMID:33291877] [10.1021/acs.jmedchem.0c01573]

Source