(R)-4,4,4-trifluoro-3-((S)-1-mercapto-3-phenylpropan-2-ylamino)butanoic acid

ID: ALA4786514

PubChem CID: 162667565

Max Phase: Preclinical

Molecular Formula: C13H16F3NO2S

Molecular Weight: 307.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)C[C@@H](N[C@H](CS)Cc1ccccc1)C(F)(F)F

Standard InChI:  InChI=1S/C13H16F3NO2S/c14-13(15,16)11(7-12(18)19)17-10(8-20)6-9-4-2-1-3-5-9/h1-5,10-11,17,20H,6-8H2,(H,18,19)/t10-,11+/m0/s1

Standard InChI Key:  QDZWCJFHWWQZEO-WDEREUQCSA-N

Molfile:  

 
     RDKit          2D

 20 20  0  0  0  0  0  0  0  0999 V2000
   11.1417  -10.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8562   -9.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5707  -10.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8562   -8.9125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4273   -9.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7128  -10.1500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4273   -8.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1417   -8.5000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.7128   -8.5000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.4209   -8.0876    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.9983   -9.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2839  -10.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9983   -8.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2839   -8.5000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.2839  -10.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5668  -11.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5665  -12.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2814  -12.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9983  -12.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9952  -11.3831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  5  6  1  0
  5  7  1  1
  7  8  1  0
  7  9  1  0
  7 10  1  0
  6 11  1  0
 11 12  1  1
 11 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4786514

    ---

Associated Targets(Human)

MME Tclin Neprilysin (838 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 307.34Molecular Weight (Monoisotopic): 307.0854AlogP: 2.52#Rotatable Bonds: 7
Polar Surface Area: 49.33Molecular Species: ACIDHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.69CX Basic pKa: 5.19CX LogP: 1.94CX LogD: 0.06
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.68Np Likeness Score: -0.17

References

1. Kumari S,Carmona AV,Tiwari AK,Trippier PC.  (2020)  Amide Bond Bioisosteres: Strategies, Synthesis, and Successes.,  63  (21.0): [PMID:32686940] [10.1021/acs.jmedchem.0c00530]

Source