1-(11-Oxo-10-pyridin-3-yl-10,11-dihydro-5-oxa-4,10-diaza-dibenzo[a,d]cyclohepten-7-yl)-3-phenyl-urea

ID: ALA4786534

PubChem CID: 162667786

Max Phase: Preclinical

Molecular Formula: C24H17N5O3

Molecular Weight: 423.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccccc1)Nc1ccc2c(c1)Oc1ncccc1C(=O)N2c1cccnc1

Standard InChI:  InChI=1S/C24H17N5O3/c30-23-19-9-5-13-26-22(19)32-21-14-17(28-24(31)27-16-6-2-1-3-7-16)10-11-20(21)29(23)18-8-4-12-25-15-18/h1-15H,(H2,27,28,31)

Standard InChI Key:  MMXUSEWWJQJNTI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    4.3746  -21.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1556  -21.6389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1794  -19.8380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7764  -21.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7781  -20.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4919  -19.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2087  -20.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2071  -21.1440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4886  -21.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4160  -20.0095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0466  -20.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2719  -20.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8607  -20.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2301  -19.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0106  -19.3464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8430  -22.0806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3347  -22.4451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9242  -19.9037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6391  -20.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3545  -19.9046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6385  -21.1429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3534  -21.5562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1227  -22.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3019  -23.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6929  -24.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9019  -23.8026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7265  -22.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0653  -21.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7797  -21.5524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7796  -22.3790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0591  -22.7913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3476  -22.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 11  1  0
  1  2  1  0
  5  3  1  0
  3 10  1  0
  2  4  1  0
  4  5  1  0
  4  9  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
 10 11  1  0
 10 15  2  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
  1 16  2  0
  2 17  1  0
  7 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 17 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 17  1  0
 22 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4786534

    ---

Associated Targets(Human)

CDK8 Tchem Cell division protein kinase 8 (1536 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.43Molecular Weight (Monoisotopic): 423.1331AlogP: 5.20#Rotatable Bonds: 3
Polar Surface Area: 96.45Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.39CX Basic pKa: 4.17CX LogP: 3.42CX LogD: 3.42
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.47

References

1. Martínez-González S,García AB,Albarrán MI,Cebriá A,Amezquita-Alves A,García-Campos FJ,Martínez-Gago J,Martínez-Torrecuadrada J,Muñoz IG,Blanco-Aparicio C,Pastor J.  (2020)  Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one derivatives as CDK8 inhibitors.,  201  [PMID:32599324] [10.1016/j.ejmech.2020.112443]

Source