The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Erythrofordin A ID: ALA4786730
PubChem CID: 162666873
Max Phase: Preclinical
Molecular Formula: C21H30O7
Molecular Weight: 394.46
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@]1(C)[C@@H]2C(=O)[C@H](O)[C@H]3[C@@H](C)/C(=C/C(=O)O)CC[C@@H]3[C@@]2(C)CC[C@@H]1O
Standard InChI: InChI=1S/C21H30O7/c1-10-11(9-14(23)24)5-6-12-15(10)16(25)17(26)18-20(12,2)8-7-13(22)21(18,3)19(27)28-4/h9-10,12-13,15-16,18,22,25H,5-8H2,1-4H3,(H,23,24)/b11-9+/t10-,12-,13-,15-,16+,18+,20+,21-/m0/s1
Standard InChI Key: SPSFGGYXNQLASU-DIOQFOCFSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
5.4356 -18.8449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0270 -18.1350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6180 -18.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3253 -16.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3253 -17.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0306 -16.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7400 -16.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7365 -17.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4427 -18.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1569 -17.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4497 -16.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1565 -16.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8686 -16.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8801 -15.6952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1732 -15.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4550 -15.6786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5970 -15.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6074 -14.4743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3243 -14.0706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9008 -14.0527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5752 -16.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7327 -16.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6141 -18.1402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7967 -18.8397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0243 -19.5555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6135 -20.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4381 -18.9612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8674 -18.1475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9473 -18.5189 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.4426 -17.3179 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.1484 -16.0962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
4 5 1 0
4 6 1 0
5 2 1 0
2 8 1 0
7 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 2 0
17 18 1 0
18 19 2 0
18 20 1 0
13 21 1 6
7 22 1 1
5 23 1 1
3 24 2 0
3 25 1 0
25 26 1 0
9 27 2 0
10 28 1 1
8 29 1 6
11 30 1 6
12 31 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 394.46Molecular Weight (Monoisotopic): 394.1992AlogP: 1.56#Rotatable Bonds: 2Polar Surface Area: 121.13Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.27CX Basic pKa: ┄CX LogP: 1.60CX LogD: -1.38Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.48Np Likeness Score: 2.64
References 1. Vo PHT,Nguyen TDT,Tran HT,Nguyen YN,Doan MT,Nguyen PH,Lien GTK,To DC,Tran MH. (2021) Cytotoxic components from the leaves of Erythrophleum fordii induce human acute leukemia cell apoptosis through caspase 3 activation and PARP cleavage., 31 [PMID:33161122 ] [10.1016/j.bmcl.2020.127673 ]