The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R,S)-3-(3-Aminopiperidine-1-carbonyl)-4,11-dihydroxyanthra[2,3-b]thiophene-5,10-dione ID: ALA4786975
PubChem CID: 162668030
Max Phase: Preclinical
Molecular Formula: C22H18N2O5S
Molecular Weight: 422.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC1CCCN(C(=O)c2csc3c(O)c4c(c(O)c23)C(=O)c2ccccc2C4=O)C1
Standard InChI: InChI=1S/C22H18N2O5S/c23-10-4-3-7-24(8-10)22(29)13-9-30-21-14(13)19(27)15-16(20(21)28)18(26)12-6-2-1-5-11(12)17(15)25/h1-2,5-6,9-10,27-28H,3-4,7-8,23H2
Standard InChI Key: SKDUUMQIHAJZOY-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
37.6637 -27.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6625 -28.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3706 -29.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3688 -27.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0774 -27.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0762 -28.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7863 -29.1660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7887 -27.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5033 -27.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5021 -28.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2114 -29.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2098 -27.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9197 -27.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9201 -28.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7018 -29.0035 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.1846 -28.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7012 -27.6739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7887 -26.6984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.7858 -29.9832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.2075 -26.7048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.2127 -29.9796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.9533 -26.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7526 -26.7263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.4062 -26.2895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2997 -27.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0048 -25.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8040 -25.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0989 -27.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3511 -26.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6460 -27.7701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 14 2 0
13 12 2 0
12 9 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
8 18 2 0
7 19 2 0
12 20 1 0
11 21 1 0
17 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
23 26 1 0
26 27 1 0
25 28 1 0
27 29 1 0
28 29 1 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.46Molecular Weight (Monoisotopic): 422.0936AlogP: 2.65#Rotatable Bonds: 1Polar Surface Area: 120.93Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.04CX Basic pKa: 9.29CX LogP: 2.52CX LogD: 2.51Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.41Np Likeness Score: -0.28
References 1. Tikhomirov AS,Litvinova VA,Andreeva DV,Tsvetkov VB,Dezhenkova LG,Volodina YL,Kaluzhny DN,Treshalin ID,Schols D,Ramonova AA,Moisenovich MM,Shtil AA,Shchekotikhin AE. (2020) Amides of pyrrole- and thiophene-fused anthraquinone derivatives: A role of the heterocyclic core in antitumor properties., 199 [PMID:32428792 ] [10.1016/j.ejmech.2020.112294 ]