The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S)-3-cyclopropyl-3-[3-[[4-(5,5-dimethylcyclopenten-1-yl)-5-(2-fluoro-5-methoxyphenyl)-2-pyridyl]methoxy]phenyl]propanoic acid ID: ALA4787007
PubChem CID: 162668241
Max Phase: Preclinical
Molecular Formula: C32H34FNO4
Molecular Weight: 515.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(F)c(-c2cnc(COc3cccc([C@@H](CC(=O)O)C4CC4)c3)cc2C2=CCCC2(C)C)c1
Standard InChI: InChI=1S/C32H34FNO4/c1-32(2)13-5-8-29(32)26-15-22(34-18-28(26)27-16-23(37-3)11-12-30(27)33)19-38-24-7-4-6-21(14-24)25(17-31(35)36)20-9-10-20/h4,6-8,11-12,14-16,18,20,25H,5,9-10,13,17,19H2,1-3H3,(H,35,36)/t25-/m0/s1
Standard InChI Key: JGZMKZHCWGDOPI-VWLOTQADSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
19.0430 -5.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2547 -5.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4666 -6.1740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0499 -3.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0487 -4.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7609 -4.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4747 -4.1580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4719 -3.3312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7591 -2.9259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1872 -4.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8984 -4.1557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6108 -4.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6075 -5.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3191 -5.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0313 -5.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0274 -4.5592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3152 -4.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7330 -4.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4469 -4.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1567 -4.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8706 -4.5448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1525 -3.3144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7288 -3.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1334 -2.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3121 -2.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3411 -4.5679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5907 -4.2308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0393 -4.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4515 -5.5540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3441 -2.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3453 -2.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6342 -1.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9215 -2.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9243 -2.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6360 -3.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0533 -1.6919 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.2140 -3.3414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5006 -2.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
18 23 1 6
24 23 1 0
25 24 1 0
23 25 1 0
26 27 2 0
27 28 1 0
28 29 1 0
29 2 1 0
2 26 1 0
5 26 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
4 30 1 0
31 36 1 0
34 37 1 0
37 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.63Molecular Weight (Monoisotopic): 515.2472AlogP: 7.65#Rotatable Bonds: 10Polar Surface Area: 68.65Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.18CX Basic pKa: 3.30CX LogP: 6.22CX LogD: 3.51Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: 0.01
References 1. Meegalla SK,Huang H,Martin T,Xu J,Zhao S,Liu J,Hall M,Gunnet J,Wang Y,Rady B,Silva J,Otieno M,Arnoult E,Paul Lee S,Pocai A,Player MR. (2018) Discovery of a novel potent GPR40 full agonist., 28 (4): [PMID:29366647 ] [10.1016/j.bmcl.2018.01.013 ]