The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2,4-difluorobiphenyl-3-ylcarboxamido)-N-(4-fluorophenyl)-1H-pyrazole-3-carboxamide ID: ALA4787022
PubChem CID: 162666963
Max Phase: Preclinical
Molecular Formula: C23H15F3N4O2
Molecular Weight: 436.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(F)cc1)c1n[nH]cc1NC(=O)c1c(F)ccc(-c2ccccc2)c1F
Standard InChI: InChI=1S/C23H15F3N4O2/c24-14-6-8-15(9-7-14)28-23(32)21-18(12-27-30-21)29-22(31)19-17(25)11-10-16(20(19)26)13-4-2-1-3-5-13/h1-12H,(H,27,30)(H,28,32)(H,29,31)
Standard InChI Key: SQNKSEHTPHLRIQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
2.9661 -12.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9649 -13.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6730 -13.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3826 -13.5887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3798 -12.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6712 -12.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0910 -13.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0923 -14.8133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7980 -13.5865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5064 -13.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5912 -14.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3908 -14.9732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7983 -14.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2505 -13.6585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4179 -12.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1943 -12.6037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8088 -12.3138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0860 -12.3547 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.9762 -11.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7520 -11.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9195 -10.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3101 -9.9184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5305 -10.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3667 -10.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2588 -13.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5511 -13.5866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8436 -13.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8425 -14.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -15.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2595 -14.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4764 -9.1184 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.6728 -14.8153 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
14 15 1 0
15 16 2 0
15 17 1 0
5 18 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
2 25 1 0
22 31 1 0
3 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.39Molecular Weight (Monoisotopic): 436.1147AlogP: 5.00#Rotatable Bonds: 5Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.28CX Basic pKa: ┄CX LogP: 4.92CX LogD: 4.92Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -1.54
References 1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B. (2021) Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors., 215 [PMID:33611192 ] [10.1016/j.ejmech.2021.113281 ]