The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Hypomycin E ID: ALA4787050
PubChem CID: 156580810
Max Phase: Preclinical
Molecular Formula: C29H26O9
Molecular Weight: 518.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC1=C2c3c4c5c(c(O)cc(OC)c5c5c(OC)cc(O)c(c35)C1=O)C(=O)C[C@]41C[C@](C)(O)[C@H]2[C@]1(C)O
Standard InChI: InChI=1S/C29H26O9/c1-27(34)9-29-8-12(32)15-10(30)6-14(37-4)18-17-13(36-3)7-11(31)16-19(17)21(23(29)20(15)18)22(25(38-5)24(16)33)26(27)28(29,2)35/h6-7,26,30-31,34-35H,8-9H2,1-5H3/t26-,27-,28-,29-/m0/s1
Standard InChI Key: HBHMUVWHVZGKTK-DZUOILHNSA-N
Molfile:
RDKit 2D
39 45 0 0 0 0 0 0 0 0999 V2000
32.5102 -15.3327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2171 -16.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0045 -15.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3893 -16.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5762 -16.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9848 -16.9649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4698 -14.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7554 -14.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0468 -14.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3543 -14.1392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6377 -14.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6377 -15.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0468 -15.3759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3552 -15.7851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7536 -18.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4312 -17.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0693 -17.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3552 -16.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6463 -17.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6463 -17.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3422 -18.2187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0513 -17.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7918 -15.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4698 -15.3529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2466 -15.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7918 -16.6446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4312 -17.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2215 -16.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7544 -13.3144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3553 -13.3261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9342 -15.7780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2347 -15.3696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9438 -16.6035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2433 -17.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7210 -19.0878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3360 -19.0276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0829 -18.3106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0710 -19.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7054 -17.6100 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 6
5 4 1 1
6 5 1 0
24 7 1 0
7 8 1 0
8 9 1 0
13 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 14 1 0
23 13 1 0
13 14 2 0
14 18 1 0
26 17 1 0
22 15 1 0
15 16 1 0
16 27 2 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
23 24 1 0
24 25 1 6
23 26 2 0
25 5 1 0
26 27 1 0
5 28 1 0
27 28 1 0
8 29 2 0
10 30 1 0
12 31 1 0
31 32 1 0
19 33 1 0
33 34 1 0
15 35 2 0
21 36 1 0
16 37 1 0
37 38 1 0
28 39 1 1
28 2 1 0
2 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.52Molecular Weight (Monoisotopic): 518.1577AlogP: 3.33#Rotatable Bonds: 3Polar Surface Area: 142.75Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.04CX Basic pKa: ┄CX LogP: 2.04CX LogD: 1.95Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.38Np Likeness Score: 1.84
References 1. Al Subeh ZY,Raja HA,Monro S,Flores-Bocanegra L,El-Elimat T,Pearce CJ,McFarland SA,Oberlies NH. (2020) Enhanced Production and Anticancer Properties of Photoactivated Perylenequinones., 83 (8): [PMID:32786877 ] [10.1021/acs.jnatprod.0c00492 ]