Hypomycin E

ID: ALA4787050

PubChem CID: 156580810

Max Phase: Preclinical

Molecular Formula: C29H26O9

Molecular Weight: 518.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC1=C2c3c4c5c(c(O)cc(OC)c5c5c(OC)cc(O)c(c35)C1=O)C(=O)C[C@]41C[C@](C)(O)[C@H]2[C@]1(C)O

Standard InChI:  InChI=1S/C29H26O9/c1-27(34)9-29-8-12(32)15-10(30)6-14(37-4)18-17-13(36-3)7-11(31)16-19(17)21(23(29)20(15)18)22(25(38-5)24(16)33)26(27)28(29,2)35/h6-7,26,30-31,34-35H,8-9H2,1-5H3/t26-,27-,28-,29-/m0/s1

Standard InChI Key:  HBHMUVWHVZGKTK-DZUOILHNSA-N

Molfile:  

 
     RDKit          2D

 39 45  0  0  0  0  0  0  0  0999 V2000
   32.5102  -15.3327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2171  -16.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0045  -15.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3893  -16.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5762  -16.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9848  -16.9649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4698  -14.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7554  -14.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0468  -14.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3543  -14.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6377  -14.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6377  -15.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0468  -15.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3552  -15.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7536  -18.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4312  -17.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0693  -17.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3552  -16.6070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6463  -17.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6463  -17.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3422  -18.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0513  -17.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7918  -15.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4698  -15.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2466  -15.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7918  -16.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4312  -17.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2215  -16.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7544  -13.3144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3553  -13.3261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9342  -15.7780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2347  -15.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9438  -16.6035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2433  -17.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7210  -19.0878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3360  -19.0276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0829  -18.3106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0710  -19.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7054  -17.6100    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  6
  5  4  1  1
  6  5  1  0
 24  7  1  0
  7  8  1  0
  8  9  1  0
 13  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 14  1  0
 23 13  1  0
 13 14  2  0
 14 18  1  0
 26 17  1  0
 22 15  1  0
 15 16  1  0
 16 27  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 23 24  1  0
 24 25  1  6
 23 26  2  0
 25  5  1  0
 26 27  1  0
  5 28  1  0
 27 28  1  0
  8 29  2  0
 10 30  1  0
 12 31  1  0
 31 32  1  0
 19 33  1  0
 33 34  1  0
 15 35  2  0
 21 36  1  0
 16 37  1  0
 37 38  1  0
 28 39  1  1
 28  2  1  0
  2 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4787050

    ---

Associated Targets(Human)

SK-MEL-28 (48833 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.52Molecular Weight (Monoisotopic): 518.1577AlogP: 3.33#Rotatable Bonds: 3
Polar Surface Area: 142.75Molecular Species: NEUTRALHBA: 9HBD: 4
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.04CX Basic pKa: CX LogP: 2.04CX LogD: 1.95
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.38Np Likeness Score: 1.84

References

1. Al Subeh ZY,Raja HA,Monro S,Flores-Bocanegra L,El-Elimat T,Pearce CJ,McFarland SA,Oberlies NH.  (2020)  Enhanced Production and Anticancer Properties of Photoactivated Perylenequinones.,  83  (8): [PMID:32786877] [10.1021/acs.jnatprod.0c00492]

Source